![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/compressed.gif) | shortsummary_12_11_2025.zip | 2026-07-27 10:17 | 79K | |
![[ ]](/icons/compressed.gif) | extra missing files.zip | 2026-07-27 10:17 | 32K | |
![[TXT]](/icons/text.gif) | BASELINE EVALUATION OF IS TARGETED FOR UPGRADE_REPORT 28-01-20221.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | BDM Booklet 1.html | 2026-07-27 10:17 | 1.9K | |
![[TXT]](/icons/text.gif) | building_standards_act.html | 2026-07-27 10:17 | 2.0K | |
![[TXT]](/icons/text.gif) | CCA-Africa-Final.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | Climate Change Response Strategy_M&E Report_2015-16 (1).html | 2026-07-27 10:17 | 1.9K | |
![[TXT]](/icons/text.gif) | Climate Change Response Strategy_M&E Report_2015-16.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | Climate Science Input into Municipal Plans_Report_2014_0.html | 2026-07-27 10:17 | 1.9K | |
![[TXT]](/icons/text.gif) | Communal Property Associations Act.html | 2026-07-27 10:17 | 2.0K | |
![[TXT]](/icons/text.gif) | Community_Schemes_Ombud_Service Act_2011.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | DEP Human Settlements Annual Report 2016-17.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | Development Facilitation Act (No. 67).html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | Energy Consumption and CO2e Emissions Database WC - Web.html | 2026-07-27 10:17 | 2.0K | |
![[TXT]](/icons/text.gif) | Extension of Security of Tenure Act (ETSA).html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | First Home Finance Brochure Sep 2023.html | 2026-07-27 10:17 | 44K | |
![[TXT]](/icons/text.gif) | first_home_finance_presentation_ppra_2024_.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | GBCSA-Certification-Pricing-Brochure-FA.html | 2026-07-27 10:17 | 2.0K | |
![[TXT]](/icons/text.gif) | Green BCSA.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | Green_Economy_Report 2022_Final.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | Growth-for-Jobs-Strategy-2023-Cabinet-Approved.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | GRPB-framework-250119A.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | home_loan_and_mortgage_act.html | 2026-07-27 10:17 | 2.0K | |
![[TXT]](/icons/text.gif) | Housing Consumer Act.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | Housing_Act_107_of_1997_0.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | Human Setllement AR2024 Website.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | Human Setllement AR2024.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | HumanSettlements2017.html | 2026-07-27 10:17 | 2.5K | |
![[TXT]](/icons/text.gif) | IDP FULL REPORT-09-2022.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | Infrastructure Development Act (No. 23).html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | IPDMArt3ValueFormoney.html | 2026-07-27 10:17 | 2.0K | |
![[TXT]](/icons/text.gif) | IUDF-2016_WEB-min.html | 2026-07-27 10:17 | 2.0K | |
![[TXT]](/icons/text.gif) | King-IV-Summary-1-November-2016.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | Medium Term Budget Policy Statement 24_25.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | Medium Term Expenditure Framework.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | MFMA.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | MOIP-challenges-and-opportunities-working-paper-2017-1.html | 2026-07-27 10:17 | 2.6K | |
![[TXT]](/icons/text.gif) | MTFonSPPReportCSD19FINAL.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | NIP 2050.html | 2026-07-27 10:17 | 2.0K | |
![[TXT]](/icons/text.gif) | NLTF 2023-2038.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | NLTF.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | PFMA.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | policy framework for the gwme system.html | 2026-07-27 10:17 | 2.4K | |
![[TXT]](/icons/text.gif) | Prevention_of_Illegal_Eviction_from_and_Unlawful_Occupation_.html | 2026-07-27 10:17 | 2.6K | |
![[TXT]](/icons/text.gif) | REDBOOK_Part_1_v1-1.html | 2026-07-27 10:17 | 23K | |
![[TXT]](/icons/text.gif) | Rental Housing Act.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | Rental Housing Amendment No. 35 of 2014.html | 2026-07-27 10:17 | 9.1K | |
![[TXT]](/icons/text.gif) | Rental_Housing_Amendment_Act 43 of2007 pdf.html | 2026-07-27 10:17 | 10K | |
![[TXT]](/icons/text.gif) | Sectional titles schemes ACt.html | 2026-07-27 10:17 | 2.4K | |
![[TXT]](/icons/text.gif) | Social Housing Act.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | Specification for OHS - Nov draft.html | 2026-07-27 10:17 | 2.0K | |
![[TXT]](/icons/text.gif) | SPLUMA.html | 2026-07-27 10:17 | 2.0K | |
![[TXT]](/icons/text.gif) | STATE OF ENVIRONMENT OUTLOOK REPORT FOR THE WESTERN CAPE 2013.html | 2026-07-27 10:17 | 2.0K | |
![[TXT]](/icons/text.gif) | Upgrading of Land Tenure Rights Act.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | Vote 33 Human Settlements_AN.html | 2026-07-27 10:17 | 23K | |
![[TXT]](/icons/text.gif) | WC Climate Change Response Strategy Biennial M&E Report (2017-18)_1.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | WC Sustainable Water Management Plan 2018.html | 2026-07-27 10:17 | 2.0K | |
![[TXT]](/icons/text.gif) | WCCCRS (CCC Response Strategy).html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | western_cape_strategic_plan_2019-2024 (PSP).html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | NDC_September_2021.html | 2026-07-27 10:17 | 22K | |
![[TXT]](/icons/text.gif) | NDP-2030-our-future-make-it-workr.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | NSDF.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | PAIA_manual_2024-25.html | 2026-07-27 10:17 | 51K | |
![[TXT]](/icons/text.gif) | RENTAL_HOUSING_TRIBUNAL2.html | 2026-07-27 10:17 | 52K | |
![[TXT]](/icons/text.gif) | SDG_Country_report.html | 2026-07-27 10:17 | 2.4K | |
![[TXT]](/icons/text.gif) | V10_WCIF_1.html | 2026-07-27 10:17 | 23K | |
![[TXT]](/icons/text.gif) | WC_Climate_Change_Response_Strategy_Biennial_M&E_Report_(2017-18)_1.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | WCIIP_2050_v1.html | 2026-07-27 10:17 | 22K | |
![[TXT]](/icons/text.gif) | WCIS2050_v1.html | 2026-07-27 10:17 | 23K | |
![[TXT]](/icons/text.gif) | Western_Cape_Climate_Change_Mitigation_Scenarios_for_the_Energy_Scenarios_Report_2015.html | 2026-07-27 10:17 | 2.4K | |
![[TXT]](/icons/text.gif) | A-Just-Transition-Framework-for-South-Africa-2022.html | 2026-07-27 10:17 | 44K | |
![[TXT]](/icons/text.gif) | BNG Housing.html | 2026-07-27 10:17 | 5.8K | |
![[TXT]](/icons/text.gif) | REPORT FLISP.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | Deeds Registries Act 47 of 1937.html | 2026-07-27 10:17 | 40K | |
![[TXT]](/icons/text.gif) | annual report 2024-2025.html | 2026-07-27 10:17 | 3.7K | |
![[TXT]](/icons/text.gif) | strategic plan 2025-2030.html | 2026-07-27 10:17 | 3.0K | |
![[TXT]](/icons/text.gif) | Rural Economy Transformation Model.html | 2026-07-27 10:17 | 3.2K | |
![[TXT]](/icons/text.gif) | Annual Performance Plan 2025-26.html | 2026-07-27 10:17 | 2.5K | |
![[TXT]](/icons/text.gif) | provincal lanuage act,1998.html | 2026-07-27 10:17 | 2.6K | |
![[TXT]](/icons/text.gif) | western cape cultural commission and cultural councils act,1998.html | 2026-07-27 10:17 | 2.6K | |
![[TXT]](/icons/text.gif) | Strategic Plan-2025-30.html | 2026-07-27 10:17 | 2.7K | |
![[TXT]](/icons/text.gif) | NPC-National-Development-Plan-Vision-2030.html | 2026-07-27 10:17 | 2.8K | |
![[TXT]](/icons/text.gif) | dlg-annual-performance-plan_2024-25_english.html | 2026-07-27 10:17 | 2.7K | |
![[TXT]](/icons/text.gif) | department-of-the-premier-strategic-plan-2025-2030.html | 2026-07-27 10:17 | 2.5K | |
![[TXT]](/icons/text.gif) | Framework for Managing Programme Performance Information.html | 2026-07-27 10:17 | 2.5K | |
![[TXT]](/icons/text.gif) | greenpapernational-strategic-planning0.html | 2026-07-27 10:17 | 2.5K | |
![[TXT]](/icons/text.gif) | national_policy_framework.html | 2026-07-27 10:17 | 2.5K | |
![[TXT]](/icons/text.gif) | White Paper on Human Resource.html | 2026-07-27 10:17 | 2.4K | |
![[TXT]](/icons/text.gif) | national Youth Policy.html | 2026-07-27 10:17 | 2.6K | |
![[TXT]](/icons/text.gif) | Public Service Act Regulations amendments as gazzeted on the 20 Oct 2023.html | 2026-07-27 10:17 | 2.8K | |
![[TXT]](/icons/text.gif) | final-alternative-and-blended-finance-framework-22.04.2025.html | 2026-07-27 10:17 | 2.5K | |
![[TXT]](/icons/text.gif) | White Paper for Social Welfare (1997).html | 2026-07-27 10:17 | 2.5K | |
![[TXT]](/icons/text.gif) | OneCape_2040.html | 2026-07-27 10:17 | 2.7K | |
![[TXT]](/icons/text.gif) | quarterly-consolidated-statement-on-municipal-finances-per-s71-7-of-the-mfma-q3-2024-25.html | 2026-07-27 10:17 | 2.8K | |
![[TXT]](/icons/text.gif) | wc-provincial-treasury-2024_25-annual-report.html | 2026-07-27 10:17 | 3.0K | |
![[TXT]](/icons/text.gif) | SAConstitution-web-eng.html | 2026-07-27 10:17 | 2.5K | |
![[TXT]](/icons/text.gif) | Agenda 2063.html | 2026-07-27 10:17 | 2.6K | |
![[TXT]](/icons/text.gif) | MTDP 2024-2029 Final Edit Version - 11 March 2025.html | 2026-07-27 10:17 | 2.8K | |
![[TXT]](/icons/text.gif) | wced-stratplan-2020-2025.html | 2026-07-27 10:17 | 2.5K | |
![[TXT]](/icons/text.gif) | wcg_dea-dp_annual-report_17-september-2025-website.html | 2026-07-27 10:17 | 2.8K | |
![[TXT]](/icons/text.gif) | constitution of republic of RSA.html | 2026-07-27 10:17 | 2.8K | |
![[TXT]](/icons/text.gif) | wced-app-2025-2026.html | 2026-07-27 10:17 | 2.6K | |
![[TXT]](/icons/text.gif) | wced-strategic-plan-2025-2030.html | 2026-07-27 10:17 | 2.8K | |
![[TXT]](/icons/text.gif) | NATIONAL EDUCATION POLICY ACT OF 1996.html | 2026-07-27 10:17 | 2.7K | |
![[TXT]](/icons/text.gif) | wcdhw-annual-report-2024-2025.html | 2026-07-27 10:17 | 2.6K | |
![[TXT]](/icons/text.gif) | wced-app-2023-2024.html | 2026-07-27 10:17 | 2.4K | |
![[TXT]](/icons/text.gif) | pocs-strategic-plan-2025-2030.html | 2026-07-27 10:17 | 2.6K | |
![[TXT]](/icons/text.gif) | wcmd-annual-report-24-25-english.html | 2026-07-27 10:17 | 2.6K | |
![[TXT]](/icons/text.gif) | Road Transportation Act 74 of 1977.html | 2026-07-27 10:17 | 2.8K | |
![[TXT]](/icons/text.gif) | 9057-wc-registration-licence-fees-2025-1.html | 2026-07-27 10:17 | 2.5K | |
![[TXT]](/icons/text.gif) | final-wcmd-strategic-plan-2025_2030.html | 2026-07-27 10:17 | 2.6K | |
![[TXT]](/icons/text.gif) | IGR Framework Act 13 of 2005.html | 2026-07-27 10:17 | 2.5K | |
![[TXT]](/icons/text.gif) | western_cape_department_of_social_development_youth_development_strategy_1.html | 2026-07-27 10:17 | 2.8K | |
![[TXT]](/icons/text.gif) | western_cape_youth_development_strategy.html | 2026-07-27 10:17 | 2.7K | |
![[TXT]](/icons/text.gif) | national landtransport amendment act 23 of 2023.html | 2026-07-27 10:17 | 2.5K | |
![[TXT]](/icons/text.gif) | 2025-03-26-gmt-strategic-plan-2025-2030-digital-version.html | 2026-07-27 10:17 | 2.7K | |
![[TXT]](/icons/text.gif) | WCPP Revised Strategic Plan 202021.html | 2026-07-27 10:17 | 2.6K | |
![[TXT]](/icons/text.gif) | the_act_-_act_no._1_of_2020_-_establishment_of_the_national_pub.html | 2026-07-27 10:17 | 2.4K | |
![[TXT]](/icons/text.gif) | industrial-policy-action-plan.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | 24 Perishable Products Export Control No9 1983 ( scanned in by court).html | 2026-07-27 10:17 | 2.6K | |
![[TXT]](/icons/text.gif) | Smartworkers-infographic-English-in-house-printing-copy-1.html | 2026-07-27 10:17 | 2.6K | |
![[TXT]](/icons/text.gif) | Policies Procedures expropriation of Land in terms of Act 126 and ESTA.html | 2026-07-27 10:17 | 2.7K | |
![[TXT]](/icons/text.gif) | Tourism Sector Recovery Plan.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | annaul performance Plan.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | 2025-Water-MIR-Final.html | 2026-07-27 10:17 | 2.5K | |
![[TXT]](/icons/text.gif) | National-Veld-Fires-Act 101 of 1998.html | 2026-07-27 10:17 | 2.7K | |
![[TXT]](/icons/text.gif) | 8359-extra-wc-environmental-implementation.html | 2026-07-27 10:17 | 3.6K | |
![[TXT]](/icons/text.gif) | SmartAgri-Climate-Change.html | 2026-07-27 10:17 | 2.7K | |
![[TXT]](/icons/text.gif) | Onderstepoort Biological Products Incorporation Act 19 of 1999.html | 2026-07-27 10:17 | 2.9K | |
![[TXT]](/icons/text.gif) | MIG pdf.html | 2026-07-27 10:17 | 3.0K | |
![[TXT]](/icons/text.gif) | ndzena-digital-future-skills-strategy.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | revised-3rd-draft-rwp-ach-february-2017.html | 2026-07-27 10:17 | 2.5K | |
![[TXT]](/icons/text.gif) | Handbook on Property Valuation.html | 2026-07-27 10:17 | 2.7K | |
![[TXT]](/icons/text.gif) | nised-masterplan.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | Veterinary and Para-Veterinary professions amendment bill 2012.html | 2026-07-27 10:17 | 2.5K | |
![[TXT]](/icons/text.gif) | western_cape_policy_on_public_participation_2010.html | 2026-07-27 10:17 | 2.6K | |
![[TXT]](/icons/text.gif) | Amended-by-Local-Government-Municipal-Structures-Amendment-Act-3-of-2021.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | PUBLIC ADMINISTRATION MANAGEMENT AMENDMENT BILL 2023.html | 2026-07-27 10:17 | 3.0K | |
![[TXT]](/icons/text.gif) | Recapitalization and Development Programme Policy.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | WEB-2025-Sustainable-Agriculture-MIR.html | 2026-07-27 10:17 | 2.5K | |
![[TXT]](/icons/text.gif) | Agricultural training institutes bursary policy.html | 2026-07-27 10:17 | 2.8K | |
![[TXT]](/icons/text.gif) | National Veld and Forest Fire Amendment Bill 2013.html | 2026-07-27 10:17 | 2.9K | |
![[TXT]](/icons/text.gif) | Agricultural training institutes working hours policy.html | 2026-07-27 10:17 | 2.6K | |
![[TXT]](/icons/text.gif) | Public Service Regulations, 2016.html | 2026-07-27 10:17 | 3.4K | |
![[TXT]](/icons/text.gif) | PAM Act2014.html | 2026-07-27 10:17 | 2.7K | |
![[TXT]](/icons/text.gif) | National Forest Act 1998.html | 2026-07-27 10:17 | 2.7K | |
![[TXT]](/icons/text.gif) | Public Service Regulation 2016 as at 1 November 2023.html | 2026-07-27 10:17 | 3.2K | |
![[TXT]](/icons/text.gif) | 2025-Renewable-Energy-MIR-regional-Final.html | 2026-07-27 10:17 | 3.1K | |
![[TXT]](/icons/text.gif) | PFM_Policy_and_Strategy_20041.html | 2026-07-27 10:17 | 2.5K | |
![[TXT]](/icons/text.gif) | Agricultural training institutes training policy.html | 2026-07-27 10:17 | 2.6K | |
![[TXT]](/icons/text.gif) | 201111Final_Cabinet_Approved_NYP_2020-2030_19_October_2020.html | 2026-07-27 10:17 | 2.9K | |
![[TXT]](/icons/text.gif) | NATIONAL STRATEGIC FRAMEWORK ON.html | 2026-07-27 10:17 | 4.0K | |
![[TXT]](/icons/text.gif) | western-cape-appropriation-act-2025.html | 2026-07-27 10:17 | 2.8K | |
![[TXT]](/icons/text.gif) | PUBLIC SERVICE AMENDMENT BILL 2023.html | 2026-07-27 10:17 | 3.2K | |
![[TXT]](/icons/text.gif) | 42394_11-4_PSA.html | 2026-07-27 10:17 | 2.9K | |
![[TXT]](/icons/text.gif) | Policy Framework for the Recapitalization.html | 2026-07-27 10:17 | 2.6K | |
![[TXT]](/icons/text.gif) | Agricultural training institutes quality assurance policy.html | 2026-07-27 10:17 | 2.7K | |
![[TXT]](/icons/text.gif) | Annual report 2024 2025__Cultural.html | 2026-07-27 10:17 | 3.0K | |
![[TXT]](/icons/text.gif) | Digital-Economy-Masterplan-22-Feb-2021v1_updated.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | Promotion of Administrative Justice Act (PAJA) (Act 3 of 2000).html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | New Employment Policy for the Public Service White Paper.html | 2026-07-27 10:17 | 4.2K | |
![[TXT]](/icons/text.gif) | dsd-popia-compliance-framework-and-privacy-notice-2025-english - Copy.html | 2026-07-27 10:17 | 2.4K | |
![[TXT]](/icons/text.gif) | cannabis implementation plan.html | 2026-07-27 10:17 | 2.6K | |
![[TXT]](/icons/text.gif) | national-tourism-sector-strategy-2016-2026.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | nsrp_final_august_2012.html | 2026-07-27 10:17 | 2.6K | |
![[TXT]](/icons/text.gif) | evaluation policy framework.html | 2026-07-27 10:17 | 2.4K | |
![[TXT]](/icons/text.gif) | Acts Constitutional Law PREFERENTIAL PROCUREMENT POLICY.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | 2015_policy_framework_-_services_to_persons_with_intellectial_disability_1.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | Framework-on-Gender-Responsive-Planning-Budgeting-Monitoring-Evaluation-and-Auditing (1).html | 2026-07-27 10:17 | 3.8K | |
![[TXT]](/icons/text.gif) | Companies Act (Act 71 of 2008).html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | Cross-boundary-Municipalities-Laws-Repeal-and-Related-Matters-Act-No-23-of-2005.html | 2026-07-27 10:17 | 2.4K | |
![[TXT]](/icons/text.gif) | PAIA.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | indigent_policy_framework_dplg_2005.html | 2026-07-27 10:17 | 2.7K | |
![[TXT]](/icons/text.gif) | Promotion of Access to Information Act (PAIA) (Act 2 of 2000).html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | indigent_policy_implementation_guidelines_dplg_part_1.html | 2026-07-27 10:17 | 2.7K | |
![[TXT]](/icons/text.gif) | MSDF_Vol_I_Ch1-6_Tech_Suppl_A.html | 2026-07-27 10:17 | 2.7K | |
![[TXT]](/icons/text.gif) | THE-SOUTH-AFRICAN-OLYMPIC-HOSTING-ACT.html | 2026-07-27 10:17 | 2.0K | |
![[TXT]](/icons/text.gif) | sexual offences programme.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | indigent_policy_implementation_guidelines_dplg_part_2.html | 2026-07-27 10:17 | 2.9K | |
![[TXT]](/icons/text.gif) | SITA Amendment Act Commence Procl 31-1-2003.html | 2026-07-27 10:17 | 2.9K | |
![[TXT]](/icons/text.gif) | State Information Technology Agency Act 88 of 1998.html | 2026-07-27 10:17 | 2.4K | |
![[TXT]](/icons/text.gif) | Framework-on-Gender-Responsive-Planning-Budgeting-Monitoring-Evaluation-and-Auditing.html | 2026-07-27 10:17 | 2.9K | |
![[TXT]](/icons/text.gif) | MTEF 2024 Guidelines.html | 2026-07-27 10:17 | 2.9K | |
![[TXT]](/icons/text.gif) | Amended-by-Local-Government-Municipal-Systems-Amendment-Act-3-of-2022.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | Strategy for Improvement of Child Care & Protection Services (2015).html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | Broad-based Black Economic Empowerment Act 53 of 2003.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | National Environmental Management Protected Areas Act 57 of 2003.html | 2026-07-27 10:17 | 2.5K | |
![[TXT]](/icons/text.gif) | Western-Cape-Biodiversity-Act-No.-6-of-2021-14-December-2021__shortname.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | TLGFA-Traditional-Leadership-and-Governance-Framework-Act-2003-Act-No-41-of-2003.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | LOCAL-GOVERNMENT-LAWS-AMENDMENT-ACT.html | 2026-07-27 10:17 | 2.0K | |
![[TXT]](/icons/text.gif) | White Paper on Population Policy (1998).html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | Supply Chain Management Policy.html | 2026-07-27 10:17 | 2.5K | |
![[TXT]](/icons/text.gif) | Environmental Strategy.html | 2026-07-27 10:17 | 2.7K | |
![[TXT]](/icons/text.gif) | Amended-by-Cross-Boundary-Municipalities-Laws-Repeal-and-Related-Matters-Act-23-of-2005.html | 2026-07-27 10:17 | 2.4K | |
![[TXT]](/icons/text.gif) | National Qualifications Framework Act 67 of 2008.html | 2026-07-27 10:17 | 2.5K | |
![[TXT]](/icons/text.gif) | REMUNERATION-OF-PUBLIC-OFFICE-BEARERS-ACT.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | TRANSFERE-OF-STAFF-OF-MUNICIPALITIES-ACT.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | Environmental Laws Rationalisation Act 51 of 1997.html | 2026-07-27 10:17 | 2.7K | |
![[TXT]](/icons/text.gif) | wc_coat_of_arms.html | 2026-07-27 10:17 | 3.4K | |
![[TXT]](/icons/text.gif) | wc-pdmc-annual-report-202425.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | national-skills-development-strategyiiia.html | 2026-07-27 10:17 | 4.3K | |
![[TXT]](/icons/text.gif) | Environmental Impact Assessment Regulations 2014.html | 2026-07-27 10:17 | 2.7K | |
![[TXT]](/icons/text.gif) | National Environmental Management Biodiversity Act 10 of 2004.html | 2026-07-27 10:17 | 2.6K | |
![[TXT]](/icons/text.gif) | WCGRB Strategic Plan 2025-2030.html | 2026-07-27 10:17 | 2.6K | |
![[TXT]](/icons/text.gif) | guidelines_pppfa_regs_-_1_december_2011_(2).html | 2026-07-27 10:17 | 2.6K | |
![[TXT]](/icons/text.gif) | PUBLIC service regulations 16 April 2019.html | 2026-07-27 10:17 | 2.4K | |
![[TXT]](/icons/text.gif) | Western Cape Commissioner for Children Act, 2019 (Act 2 of 2019).html | 2026-07-27 10:17 | 3.3K | |
![[TXT]](/icons/text.gif) | evaluationpolicyframework-approved-11-11-23a.html | 2026-07-27 10:17 | 2.8K | |
![[TXT]](/icons/text.gif) | SA SDG Country Report 2023.html | 2026-07-27 10:17 | 2.7K | |
![[TXT]](/icons/text.gif) | Amended-by-Local-Government-Municipal-Systems-Amendment-Act-7-of-2011.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | pubemploy0.html | 2026-07-27 10:17 | 4.4K | |
![[TXT]](/icons/text.gif) | Amended-by-Small-Business-Tax-Amnesty-and-Amendment-of-Taxation-Laws-Act-9-of-2006.html | 2026-07-27 10:17 | 2.4K | |
![[TXT]](/icons/text.gif) | Transforming Public Service Delivery White Paper (Batho Pele White Paper).html | 2026-07-27 10:17 | 4.0K | |
![[TXT]](/icons/text.gif) | 37119gon953.html | 2026-07-27 10:17 | 3.6K | |
![[TXT]](/icons/text.gif) | dpsastratframework2006-2015241120060.html | 2026-07-27 10:17 | 4.3K | |
![[TXT]](/icons/text.gif) | Vote 09 - Environmental Affairs and Development Planning.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | Consolidated WCGR Act 02122020 (003).html | 2026-07-27 10:17 | 2.7K | |
![[TXT]](/icons/text.gif) | dsd-strategic-plan-2025-2030_0.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | supervision_framework_for_the_social_work_profession_in_south_africa_2012.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | Supervision-Framework-Booklet.html | 2026-07-27 10:17 | 2.4K | |
![[TXT]](/icons/text.gif) | drug-master-plan.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | pt_service_schedule_standards_march_2014_draft_amended_26march_2015.html | 2026-07-27 10:17 | 2.5K | |
![[TXT]](/icons/text.gif) | NATIONAL-DRUG-MASTER-PLAN_V5-2019-2024.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | Provincial Treasury Service Delivery Improvement Plan SDIP 2023_0.html | 2026-07-27 10:17 | 2.7K | |
![[TXT]](/icons/text.gif) | national environmental managment air quality act,2004.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | Disaster Management Act 57 of 2002.html | 2026-07-27 10:17 | 2.6K | |
![[TXT]](/icons/text.gif) | medium term developmen plan (MTDP) 2024-2029.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | white paper Gazetted 31 January 2025.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | South African Weather Service Act 8 of 2001.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | WC Climate Change Mitigation Scenarios__Energy_2015.html | 2026-07-27 10:17 | 2.4K | |
![[TXT]](/icons/text.gif) | RENTAL HOUSING TRIBUNAL.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | Western Cape Climate Change Response Strategy_vision_2050_march_2022.html | 2026-07-27 10:17 | 3.0K | |
![[TXT]](/icons/text.gif) | consumer Managment Act.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | DHSS.html | 2026-07-27 10:17 | 2.4K | |
![[TXT]](/icons/text.gif) | provincial-spatial-development-framework.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | paia-manual-dsd-2025.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | Stormwater.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | service-standards-schedule-2025_26.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | DEPARTMENT OF SOCIAL DEVELOPMENT REPUBLIC OF SOUTH.html | 2026-07-27 10:17 | 2.5K | |
![[TXT]](/icons/text.gif) | generic_norms_and_standards_for_social_welfare_services.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | psp-2025-30.html | 2026-07-27 10:17 | 2.0K | |
![[TXT]](/icons/text.gif) | Discount benefit scheme.html | 2026-07-27 10:17 | 2.0K | |
![[TXT]](/icons/text.gif) | 044_-_policy_on_social_development_services_to_persons_with_disabilities_apr_2017.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | Subsidy social housing.html | 2026-07-27 10:17 | 2.0K | |
![[TXT]](/icons/text.gif) | TOWARDS POLICY FOUNDATION FOR THEHUMAN SETTLEMENTS LEGILATION - 01 NOVEMBER 2015(3) (1).html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | vote-3-annual-performance-plan-2025_26-provincial-treasury-copy.html | 2026-07-27 10:17 | 2.7K | |
![[TXT]](/icons/text.gif) | financial recovery Plan November 2021.html | 2026-07-27 10:17 | 2.9K | |
![[TXT]](/icons/text.gif) | National Environmental Management Waste Act 59 of 2008.html | 2026-07-27 10:17 | 2.5K | |
![[TXT]](/icons/text.gif) | CT_Spatial_Development_Framework.html | 2026-07-27 10:17 | 2.4K | |
![[TXT]](/icons/text.gif) | hazardous substance act.html | 2026-07-27 10:17 | 2.7K | |
![[TXT]](/icons/text.gif) | WCSDF 2014 PSDF Annexures.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | Consumer Protection Act.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | Home Loan and Mortgage Disclosure Act 63 of 2000.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | vote-3-strategic-plan-2025_30-provincial-treasury-copy.html | 2026-07-27 10:17 | 2.6K | |
![[TXT]](/icons/text.gif) | Revised Framework for Strategic Plans and Annual Performance Plans.html | 2026-07-27 10:17 | 2.7K | |
![[TXT]](/icons/text.gif) | National_Infrastructure_Plan.html | 2026-07-27 10:17 | 2.7K | |
![[TXT]](/icons/text.gif) | Forestry Laws Amendment Act 35 of 2005.html | 2026-07-27 10:17 | 2.5K | |
![[TXT]](/icons/text.gif) | National Environmental Management Act 107 of 1998.html | 2026-07-27 10:17 | 2.7K | |
![[TXT]](/icons/text.gif) | national treasury regulations 2005.html | 2026-07-27 10:17 | 3.0K | |
![[TXT]](/icons/text.gif) | DHS FINAL 2025-30 STRATEGIC PLAN 31 MARCH 2025.html | 2026-07-27 10:17 | 2.6K | |
![[TXT]](/icons/text.gif) | REDBOOK_Part_1_(Planning & design guidelines).html | 2026-07-27 10:17 | 2.4K | |
![[TXT]](/icons/text.gif) | FHF-BROCHURE-Sep-2023_WhatisFHF.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | Environment2017.html | 2026-07-27 10:17 | 2.7K | |
![[TXT]](/icons/text.gif) | National Veld and Forest Fire Act 101 of 1998.html | 2026-07-27 10:17 | 2.5K | |
![[TXT]](/icons/text.gif) | Extension of Security of Tenure Act_.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | Delegation Principles for Financial Management act.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | human_resource_allocation_analyses_report.html | 2026-07-27 10:17 | 2.4K | |
![[TXT]](/icons/text.gif) | Reconstruction and Development Programme Fund Act 7 of 1994.html | 2026-07-27 10:17 | 2.4K | |
![[TXT]](/icons/text.gif) | Social Housing-Regulations-Booklet_.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | Energy Consumption &CO2e Emissions Database WC - Web.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | Vote 33 Human Settlements.html | 2026-07-27 10:17 | 2.5K | |
![[TXT]](/icons/text.gif) | Policy_Guideline_for_EPWP_final_10_2011.html | 2026-07-27 10:17 | 2.9K | |
![[TXT]](/icons/text.gif) | Alternative and Sustainable Infrastructure Solutions for Human Settlements_Study_2017.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | NDC September 2021.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | WCSDF 2014 PSDF Annexures (3).html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | WC EIIF GE Ref Group.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | Evaluation of the Impact of the Rural Housing Programme.html | 2026-07-27 10:17 | 2.4K | |
![[TXT]](/icons/text.gif) | Infrastructure development act_.html | 2026-07-27 10:17 | 3.0K | |
![[TXT]](/icons/text.gif) | Integrated residential development program.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | policy and implementation framewrok.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | PHP Policy Framework 2008.html | 2026-07-27 10:17 | 2.4K | |
![[TXT]](/icons/text.gif) | handbook_for_municipal_councillors_.html | 2026-07-27 10:17 | 2.4K | |
![[TXT]](/icons/text.gif) | Consolidation subsidy.html | 2026-07-27 10:17 | 2.0K | |
![[TXT]](/icons/text.gif) | Approved DHS AR 2019-2020-2026.html | 2026-07-27 10:17 | 2.8K | |
![[TXT]](/icons/text.gif) | First Home Finance_Booklet.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | individual-subsidy.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | DHS_21-22 AR.html | 2026-07-27 10:17 | 2.7K | |
![[TXT]](/icons/text.gif) | Framework for Women (Policy Framework).html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | rental housing bill.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | Western Cape Liquor Act, 2008, Act 4 of 2008.html | 2026-07-27 10:17 | 2.4K | |
![[TXT]](/icons/text.gif) | PAIA_Manual.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | NDHS Proposed Language Policy - Final Draft_-.html | 2026-07-27 10:17 | 2.5K | |
![[TXT]](/icons/text.gif) | 26082014_BNG2004_0.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | Schemes_Ombud_Service Act.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | pocs-app-2025-26_1.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | Housing_Amendment_Bill.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | social housing Act,2008.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | Community Residential Units_0.html | 2026-07-27 10:17 | 2.4K | |
![[TXT]](/icons/text.gif) | Housing_Act_107_of_1997.html | 2026-07-27 10:17 | 2.0K | |
![[TXT]](/icons/text.gif) | dpocs_app_2024-25.html | 2026-07-27 10:17 | 2.6K | |
![[TXT]](/icons/text.gif) | act85of1993.html | 2026-07-27 10:17 | 2.4K | |
![[TXT]](/icons/text.gif) | DTPW Annual Performance Plan Afrikaans 2019-2020.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | sp2010-english.html | 2026-07-27 10:17 | 2.0K | |
![[TXT]](/icons/text.gif) | 2020 - 2025 NDHS STRATEGIC PLAN.html | 2026-07-27 10:17 | 2.6K | |
![[TXT]](/icons/text.gif) | B21-2018 (Property Practitioners)_0.html | 2026-07-27 10:17 | 2.4K | |
![[TXT]](/icons/text.gif) | research_study_on_the_demilitarisation_of_saps-policy_brief.html | 2026-07-27 10:17 | 2.5K | |
![[TXT]](/icons/text.gif) | National development Plan 2030.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | HIVAIDS public schools (Gazette 20372, Notice 1926) 10 Aug 1999.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | BASELINE EVALUATION OF IS TARGETED FOR UPGRADE.html | 2026-07-27 10:17 | 2.8K | |
![[TXT]](/icons/text.gif) | sectional Titles managment act,2011.html | 2026-07-27 10:17 | 2.0K | |
![[TXT]](/icons/text.gif) | RENTAL_HOUSING_ACT.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | Social_Housing_Bill.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | Pie amendment bill ( second copy).html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | Development Facilitation Act_.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | Mbambisa & Others v Nelson Mandela Bay Municipality_.html | 2026-07-27 10:17 | 2.4K | |
![[TXT]](/icons/text.gif) | western cape provincial school education act, 1997.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | e_pregnancy.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | western cape provincial school education, act 1997.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | policiy-and-criteria (2).html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | dsd-annual-report-24_25.html | 2026-07-27 10:17 | 2.4K | |
![[TXT]](/icons/text.gif) | NATIONAL NORMS AND STANDARDS FOR SCHOOL FUNDING (1).html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | 1.3.-CHAPTER-3-SURVEY-REGULATIONS-AND-STANDARDS-OF-ACCURACY-Version-2.0.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | wcape-education-amend-bill2010.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | LanguageEducationPolicy1997.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | wced-app-2024-2025.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | ENE Vote 33 Human Settlements for 2023.html | 2026-07-27 10:17 | 2.5K | |
![[TXT]](/icons/text.gif) | Habitat Council v Minister of Land Affairs and Others_.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | south african schools act No 84 of 1996.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | WESTERN CAPE MARCH 2024 NOTABLE CASE 23072024.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | Prevention of Illegal Eviction from and Unlawful Occupation of Land Act 19 of 1998.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | PIE-Amendment_Bill.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | Human_settlements_MSP_final_document_25_May (1).html | 2026-07-27 10:17 | 2.7K | |
![[TXT]](/icons/text.gif) | MTSF 2014-2019_.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | 73556-wcg-provincial-notice-20x7-eng-ctimes.html | 2026-07-27 10:17 | 2.4K | |
![[TXT]](/icons/text.gif) | Repeal of Proviso on Compulsory Offering of Accounting with Mathematics.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | Breaking New Ground.html | 2026-07-27 10:17 | 2.4K | |
![[TXT]](/icons/text.gif) | FINAL EDITED 12-2021 BASELINE EVALUATION OF IS TARGETED FOR UPGRADE_REPORT 28-01-20221 (1) (1).html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | IDP_Annual_Report.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | dsd-annual-performance-plan-2025-26.html | 2026-07-27 10:17 | 2.5K | |
![[TXT]](/icons/text.gif) | HousingConsAmendBill.2006.GG_.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | Community_Schemes_Ombud_Service Act.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | communal Property Associates Act.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | wc_act3-2010._ambulance_services_act._3_languages.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | 2022.04.21_oversight_report_2020_21_1.html | 2026-07-27 10:17 | 2.5K | |
![[TXT]](/icons/text.gif) | Policy on the Organisation, Roles and Responsibilities of Education Districts.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | Provincial Media Policy.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | ebp_resource_guide_final_complete_new_0.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | WC-CPF-INTRODUCTORY HANDBOOK-v022025.html | 2026-07-27 10:17 | 2.5K | |
![[TXT]](/icons/text.gif) | annual performance plan 2025-2026.html | 2026-07-27 10:17 | 2.7K | |
![[TXT]](/icons/text.gif) | 251001Draft_Western_Cape_Safety_Plan_2025-2030_-_V3.0_-_22_Aug_2025.html | 2026-07-27 10:17 | 2.4K | |
![[TXT]](/icons/text.gif) | Medium Term Budget Policy Statement 2020.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | PSP_western_cape_strategic_plan_2019-2024 (PSP).html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | wced-sector-analysis_website.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | wcdhw_sp_strategic_plan_2025-2030_digital.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | employers educators act.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | 2025-paia-manual-eng.html | 2026-07-27 10:17 | 2.0K | |
![[TXT]](/icons/text.gif) | pocs-strategic-plan-2025-2030_0.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | annual reports 2015-2020.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | No. 5 of 2009 National Land Transport Act, 2009.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | dsd-paia-manual-section-15-english-2025.html | 2026-07-27 10:17 | 2.0K | |
![[TXT]](/icons/text.gif) | MTDP 2024-2029 .html | 2026-07-27 10:17 | 2.0K | |
![[TXT]](/icons/text.gif) | Notice of the list of protected tree species__shortname.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | WCPP Revised Strategic Plan 202021-202425 (Revised Nov 2023).html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | DTPW Annual Performance Plan 2020-2021.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | PLANT BREEDERS’ RIGHTS ACT 12 OF 2018 ( replace the 1976 one).html | 2026-07-27 10:17 | 2.0K | |
![[TXT]](/icons/text.gif) | National_Veld_and_Forest_Fire_Act_index_only.html | 2026-07-27 10:17 | 2.6K | |
![[TXT]](/icons/text.gif) | Strategic plan 2025-2030__agriculture.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | CROSS-BORDER-ROAD-TRANSPORT-ACT4-OF-1998.html | 2026-07-27 10:17 | 2.4K | |
![[TXT]](/icons/text.gif) | bapela-stoop-2016-unpacking-the-rental-housing-amendment-act-35-of-2014 (3).html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | wc-pbs_policy-july-2025.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | policiy-and-criteria.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | policiy-and-criteria (1).html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | western_cape_government_safety_plan.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | National Education Policy Act Norms and standards for educators.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | wc_act3-2010._ambulance_services_act._3_languages (1).html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | IS-52regulations.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | WCGHW-Annual-Report-2017_2018_0.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | western cape Health Facility Boards Act, 2001.html | 2026-07-27 10:17 | 2.4K | |
![[TXT]](/icons/text.gif) | NATIONAL NORMS AND STANDARDS FOR SCHOOL FUNDING.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | a5-dsd-citizens-report-24_25-digital.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | drowning_framework.html | 2026-07-27 10:17 | 2.0K | |
![[TXT]](/icons/text.gif) | WCGHW-Annual-Report_2021-2022.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | wcghw-annual-report-2023-2024.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | final-wcmd-strategic-plan-2025_2030 (1).html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | RegCondAdminManageNSC.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | child_care_act_74_of_1983.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | Medium Term Budget Policy Statement Speech 2020.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | basic_assessment_report-april-2024.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | DTPW Annual Performance Plan 2022-2023.html | 2026-07-27 10:17 | 1.9K | |
![[TXT]](/icons/text.gif) | community_courts_western_cape.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | epwp-empowerment-youth-16-september-2025.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | compliance-notice-in-terms-of-section-83-3-d-of-paia.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | WC Climate Change Response Strategy Biennial M&E Report (2017-18)_1 (1).html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | f-c-exorbitant-increase-in-rental.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | National Environmental Management Integrated Coastal__shortname.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | f-g-failure-to-do-maintenance.html | 2026-07-27 10:17 | 2.0K | |
![[TXT]](/icons/text.gif) | National-Integrated-ICT-Policy.html | 2026-07-27 10:17 | 2.7K | |
![[TXT]](/icons/text.gif) | f-e-failure-to-provide-municipal-services.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | Annual Performance Plan 2025-26__Economic_dev.html | 2026-07-27 10:17 | 2.9K | |
![[TXT]](/icons/text.gif) | f-h-unlawful-eviction-or-unlawful-lockout.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | dsd-popia-privacy-notice-english-2025.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | 8635-WC-Registration-Licence-Fees-2022.html | 2026-07-27 10:17 | 2.0K | |
![[TXT]](/icons/text.gif) | PLTF Western Cape 2024-2028 20250721.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | protection of personal information act.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | implementation framework.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | rental housing tribunal-annual-report-2024-2025-final.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | Legal succesion to the South African Transport Service Act.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | pre-emptive-right-policy.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | DTPW Annual Report 2021-2022.html | 2026-07-27 10:17 | 2.0K | |
![[TXT]](/icons/text.gif) | western_cape_strategic_plan_2019-2024_1.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | ME-Evidence-Informing-Budgets-and-Planning-Guideline-SA.html | 2026-07-27 10:17 | 2.4K | |
![[TXT]](/icons/text.gif) | medium term development plan 2024-2029.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | Policy on Learner Attendance 2010.html | 2026-07-27 10:17 | 2.0K | |
![[TXT]](/icons/text.gif) | rlv_app_registration_licence_motor_vehicle.html | 2026-07-27 10:17 | 2.0K | |
![[TXT]](/icons/text.gif) | Municipality Survey Form for Emergency Housing Grant.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | National Environment Management Air Quality Act 39 of 2004.html | 2026-07-27 10:17 | 3.5K | |
![[TXT]](/icons/text.gif) | f-i-unilateral-changes-to-agreement.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | WCIF__V10 - WCIF_ 1.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | western-cape-provincial-school-education-amend-bills-b1-2018_final.html | 2026-07-27 10:17 | 2.7K | |
![[TXT]](/icons/text.gif) | Agenda 2063_The_Africa.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | doi-final-annual report to citizen-2024-25.html | 2026-07-27 10:17 | 2.4K | |
![[TXT]](/icons/text.gif) | WCIS__2050 V4_Final.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | deadp-smartprocurement-analysis-report.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | Strategic Plan-2025-30__Economic_dev.html | 2026-07-27 10:17 | 2.7K | |
![[TXT]](/icons/text.gif) | WCIIP__V4 FINAL_ WCIIP 2050.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | Annual report 2024-2025__agriculture.html | 2026-07-27 10:17 | 2.7K | |
![[TXT]](/icons/text.gif) | General-Laws-Loss-of-Membership-Amendment-Act__shortname.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | White2520on2520rights2520person2520disabilities_25202015.html | 2026-07-27 10:17 | 2.4K | |
![[TXT]](/icons/text.gif) | scm_guidelines_Nat_Treasury.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | wc-provincial-treasury-2022_23-annual-report.html | 2026-07-27 10:17 | 2.4K | |
![[TXT]](/icons/text.gif) | annual-performance-plan_2024-25__DLG.html | 2026-07-27 10:17 | 2.8K | |
![[TXT]](/icons/text.gif) | f-o-claim-for-remission-of-rental.html | 2026-07-27 10:17 | 2.0K | |
![[TXT]](/icons/text.gif) | f-b-unlawful-notice-to-vacate.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | National Small Enterprise Act (Act 102 of 1996).html | 2026-07-27 10:17 | 2.6K | |
![[TXT]](/icons/text.gif) | Strategic Plan-2025-30__eco_dev_Tourism.html | 2026-07-27 10:17 | 2.5K | |
![[TXT]](/icons/text.gif) | 13357-dedat-annual-report_full-report.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | Municipal Emergency Housing Grant Application form.html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | contractor-development-programme.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | NLTF 2023-2028.html | 2026-07-27 10:17 | 2.2K | |
![[TXT]](/icons/text.gif) | final-annual-operational-2025-26__DOI.html | 2026-07-27 10:17 | 2.5K | |
![[TXT]](/icons/text.gif) | social.crime-prevention.brochure.html | 2026-07-27 10:17 | 2.3K | |
![[TXT]](/icons/text.gif) | Onderstepoort Biological Products Incorporation Act 19 of 1999.pdf.html | 2026-07-27 10:17 | 2.9K | |
![[TXT]](/icons/text.gif) | annaul performance Plan .html | 2026-07-27 10:17 | 2.1K | |
![[TXT]](/icons/text.gif) | No. 54 of 2003 Spatial Data Infrastructure Act, 2003.html | 2026-07-27 10:17 | 2.4K | |
|