![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | audio/ | 2026-07-27 10:17 | - | |
![[DIR]](/icons/folder.gif) | longsummary/ | 2026-07-27 10:17 | - | |
![[DIR]](/icons/folder.gif) | shortsummary/ | 2026-07-27 10:17 | - | |
![[ ]](/icons/layout.gif) | National_Veld_and_Forest_Fire_Act_index_only.pdf | 2026-07-27 10:16 | 4.8K | |
![[ ]](/icons/unknown.gif) | Rental_Housing_Amendment_Act_2014.docx | 2026-07-27 10:16 | 14K | |
![[ ]](/icons/layout.gif) | provincal lanuage act,1998.pdf | 2026-07-27 10:15 | 17K | |
![[ ]](/icons/layout.gif) | Acts Constitutional Law PREFERENTIAL PROCUREMENT POLICY.pdf | 2026-07-27 10:16 | 18K | |
![[ ]](/icons/layout.gif) | e_pregnancy.pdf | 2026-07-27 10:16 | 20K | |
![[ ]](/icons/layout.gif) | western cape cultural commission and cultural councils act,1998.pdf | 2026-07-27 10:15 | 20K | |
![[ ]](/icons/layout.gif) | home_loan_and_mortgage_act.pdf | 2026-07-27 10:16 | 24K | |
![[ ]](/icons/layout.gif) | western cape Health Facility Boards Act, 2001.pdf | 2026-07-27 10:16 | 28K | |
![[ ]](/icons/layout.gif) | THE-SOUTH-AFRICAN-OLYMPIC-HOSTING-ACT.pdf | 2026-07-27 10:16 | 29K | |
![[ ]](/icons/layout.gif) | Veterinary and Para-Veterinary professions amendment bill 2012.pdf | 2026-07-27 10:16 | 35K | |
![[ ]](/icons/layout.gif) | Medium Term Expenditure Framework.pdf | 2026-07-27 10:16 | 39K | |
![[ ]](/icons/layout.gif) | Pie amendment bill ( second copy).pdf | 2026-07-27 10:16 | 42K | |
![[ ]](/icons/layout.gif) | TRANSFERE-OF-STAFF-OF-MUNICIPALITIES-ACT.pdf | 2026-07-27 10:16 | 43K | |
![[ ]](/icons/layout.gif) | National-Veld-Fires-Act 101 of 1998.pdf | 2026-07-27 10:16 | 51K | |
![[ ]](/icons/layout.gif) | wc_act3-2010._ambulance_services_act._3_languages (1).pdf | 2026-07-27 10:16 | 56K | |
![[ ]](/icons/layout.gif) | wc_act3-2010._ambulance_services_act._3_languages.pdf | 2026-07-27 10:16 | 56K | |
![[ ]](/icons/layout.gif) | Prevention of Illegal Eviction from and Unlawful Occupation of Land Act 19 of 1998.pdf | 2026-07-27 10:16 | 56K | |
![[ ]](/icons/layout.gif) | Prevention of Illegal Eviction from and Unlawful Occupation of Land Act_.pdf | 2026-07-27 10:16 | 56K | |
![[ ]](/icons/layout.gif) | SITA Amendment Act Commence Procl 31-1-2003.pdf | 2026-07-27 10:16 | 60K | |
![[ ]](/icons/layout.gif) | western cape provincial school education, act 1997.pdf | 2026-07-27 10:16 | 61K | |
![[ ]](/icons/layout.gif) | New Employment Policy for the Public Service White Paper.pdf | 2026-07-27 10:16 | 63K | |
![[ ]](/icons/layout.gif) | pubemploy0.pdf | 2026-07-27 10:16 | 63K | |
![[ ]](/icons/layout.gif) | Medium Term Budget Policy Statement Speech 2020.pdf | 2026-07-27 10:16 | 68K | |
![[ ]](/icons/layout.gif) | employers educators act.pdf | 2026-07-27 10:16 | 70K | |
![[ ]](/icons/layout.gif) | Promotion of Administrative Justice Act (PAJA) (Act 3 of 2000).pdf | 2026-07-27 10:16 | 72K | |
![[ ]](/icons/layout.gif) | National Forest Act 1998.pdf | 2026-07-27 10:16 | 97K | |
![[ ]](/icons/layout.gif) | individual-subsidy.pdf | 2026-07-27 10:16 | 100K | |
![[ ]](/icons/layout.gif) | Onderstepoort Biological Products Incorporation Act 19 of 1999.pdf | 2026-07-27 10:16 | 110K | |
![[ ]](/icons/layout.gif) | White Paper on Human Resource.pdf | 2026-07-27 10:16 | 112K | |
![[ ]](/icons/layout.gif) | community_courts_western_cape.pdf | 2026-07-27 10:16 | 113K | |
![[ ]](/icons/layout.gif) | social housing Act,2008.pdf | 2026-07-27 10:16 | 114K | |
![[ ]](/icons/layout.gif) | PUBLIC ADMINISTRATION MANAGEMENT AMENDMENT BILL 2023.pdf | 2026-07-27 10:16 | 123K | |
![[ ]](/icons/layout.gif) | pt_service_schedule_standards_march_2014_draft_amended_26march_2015.pdf | 2026-07-27 10:16 | 124K | |
![[ ]](/icons/layout.gif) | wc_coat_of_arms.pdf | 2026-07-27 10:16 | 127K | |
![[ ]](/icons/layout.gif) | Home Loan and Mortgage Disclosure Act.pdf | 2026-07-27 10:16 | 138K | |
![[ ]](/icons/layout.gif) | Home Loan and Mortgage Disclosure Act 63 of 2000.pdf | 2026-07-27 10:16 | 138K | |
![[ ]](/icons/layout.gif) | Community_Schemes_Ombud_Service Act.pdf | 2026-07-27 10:16 | 143K | |
![[ ]](/icons/layout.gif) | Schemes_Ombud_Service Act.pdf | 2026-07-27 10:16 | 143K | |
![[ ]](/icons/layout.gif) | 1.3.-CHAPTER-3-SURVEY-REGULATIONS-AND-STANDARDS-OF-ACCURACY-Version-2.0.pdf | 2026-07-27 10:16 | 146K | |
![[ ]](/icons/layout.gif) | HIVAIDS public schools (Gazette 20372, Notice 1926) 10 Aug 1999.pdf | 2026-07-27 10:16 | 146K | |
![[ ]](/icons/layout.gif) | PFM_Policy_and_Strategy_20041.pdf | 2026-07-27 10:16 | 150K | |
![[ ]](/icons/layout.gif) | sexual offences programme.pdf | 2026-07-27 10:16 | 150K | |
![[ ]](/icons/layout.gif) | LanguageEducationPolicy1997.pdf | 2026-07-27 10:16 | 151K | |
![[ ]](/icons/layout.gif) | National Qualifications Framework Act 67 of 2008.pdf | 2026-07-27 10:16 | 151K | |
![[ ]](/icons/layout.gif) | Environmental Laws Rationalisation Act 51 of 1997.pdf | 2026-07-27 10:16 | 154K | |
![[ ]](/icons/layout.gif) | WESTERN CAPE MARCH 2024 NOTABLE CASE 23072024.pdf | 2026-07-27 10:16 | 162K | |
![[ ]](/icons/layout.gif) | Framework for Women (Policy Framework).pdf | 2026-07-27 10:16 | 163K | |
![[ ]](/icons/layout.gif) | PUBLIC SERVICE AMENDMENT BILL 2023.pdf | 2026-07-27 10:16 | 164K | |
![[ ]](/icons/layout.gif) | Specification for OHS - Nov draft.pdf | 2026-07-27 10:16 | 176K | |
![[ ]](/icons/layout.gif) | dsd-popia-privacy-notice-english-2025.pdf | 2026-07-27 10:16 | 179K | |
![[ ]](/icons/layout.gif) | Agricultural training institutes training policy.pdf | 2026-07-27 10:16 | 179K | |
![[ ]](/icons/layout.gif) | Medium Term Budget Policy Statement 24_25.pdf | 2026-07-27 10:16 | 180K | |
![[ ]](/icons/layout.gif) | Extension of Security of Tenure Act_.pdf | 2026-07-27 10:16 | 183K | |
![[ ]](/icons/layout.gif) | Forestry Laws Amendment Act 35 of 2005.pdf | 2026-07-27 10:16 | 184K | |
![[ ]](/icons/layout.gif) | Handbook on Property Valuation.pdf | 2026-07-27 10:16 | 190K | |
![[ ]](/icons/layout.gif) | rental housing bill.pdf | 2026-07-27 10:16 | 190K | |
![[ ]](/icons/layout.gif) | Agricultural training institutes quality assurance policy.pdf | 2026-07-27 10:16 | 192K | |
![[ ]](/icons/layout.gif) | Social_Housing_Bill.pdf | 2026-07-27 10:16 | 194K | |
![[ ]](/icons/layout.gif) | Agricultural training institutes working hours policy.pdf | 2026-07-27 10:16 | 194K | |
![[ ]](/icons/layout.gif) | National Veld and Forest Fire Amendment Bill 2013.pdf | 2026-07-27 10:16 | 195K | |
![[ ]](/icons/layout.gif) | rha1999171.pdf | 2026-07-27 10:16 | 199K | |
![[ ]](/icons/layout.gif) | Policy Framework for the GWME system.pdf | 2026-07-27 10:16 | 202K | |
![[ ]](/icons/layout.gif) | policy framework for the gwme system.pdf | 2026-07-27 10:16 | 202K | |
![[ ]](/icons/layout.gif) | 42394_11-4_PSA.pdf | 2026-07-27 10:16 | 204K | |
![[ ]](/icons/layout.gif) | Rental Housing Amendment No. 35 of 2014.pdf | 2026-07-27 10:16 | 209K | |
![[ ]](/icons/layout.gif) | Rental housing Amendment Act No 35 of 2014.pdf | 2026-07-27 10:16 | 209K | |
![[ ]](/icons/layout.gif) | First Home Finance_Booklet.pdf | 2026-07-27 10:16 | 210K | |
![[ ]](/icons/layout.gif) | Rental_Housing_Amendment_Act 43 of2007 pdf.pdf | 2026-07-27 10:16 | 212K | |
![[ ]](/icons/layout.gif) | Rental housing Amendment Act 43 of 2007.pdf | 2026-07-27 10:16 | 212K | |
![[ ]](/icons/layout.gif) | Agricultural training institutes bursary policy.pdf | 2026-07-27 10:16 | 213K | |
![[ ]](/icons/layout.gif) | Habitat Council v Minister of Land Affairs and Others_.pdf | 2026-07-27 10:16 | 220K | |
![[ ]](/icons/layout.gif) | indigent_policy_framework_dplg_2005.pdf | 2026-07-27 10:16 | 226K | |
![[ ]](/icons/layout.gif) | indigent_policy_implementation_guidelines_dplg_part_2.pdf | 2026-07-27 10:16 | 228K | |
![[ ]](/icons/layout.gif) | child_care_act_74_of_1983.pdf | 2026-07-27 10:16 | 228K | |
![[ ]](/icons/layout.gif) | service-standards-schedule-2025_26.pdf | 2026-07-27 10:16 | 230K | |
![[ ]](/icons/layout.gif) | Housing Consumer Act.pdf | 2026-07-27 10:15 | 233K | |
![[ ]](/icons/layout.gif) | consumer Managment Act.pdf | 2026-07-27 10:16 | 234K | |
![[ ]](/icons/layout.gif) | national treasury regulations 2005.pdf | 2026-07-27 10:16 | 236K | |
![[ ]](/icons/layout.gif) | western_cape_government_safety_plan.pdf | 2026-07-27 10:16 | 237K | |
![[ ]](/icons/layout.gif) | 8635-WC-Registration-Licence-Fees-2022.pdf | 2026-07-27 10:16 | 243K | |
![[ ]](/icons/layout.gif) | CROSS-BORDER-ROAD-TRANSPORT-ACT4-OF-1998.pdf | 2026-07-27 10:16 | 248K | |
![[ ]](/icons/layout.gif) | Public Service Regulations, 2016.pdf | 2026-07-27 10:16 | 250K | |
![[ ]](/icons/layout.gif) | south african schools act No 84 of 1996.pdf | 2026-07-27 10:16 | 255K | |
![[ ]](/icons/layout.gif) | Strategy for Improvement of Child Care & Protection Services (2015).pdf | 2026-07-27 10:16 | 255K | |
![[ ]](/icons/layout.gif) | PUBLIC service regulations 16 April 2019.pdf | 2026-07-27 10:16 | 256K | |
![[ ]](/icons/layout.gif) | indigent_policy_implementation_guidelines_dplg_part_1.pdf | 2026-07-27 10:16 | 259K | |
![[ ]](/icons/layout.gif) | Amended-by-Local-Government-Municipal-Systems-Amendment-Act-3-of-2022.pdf | 2026-07-27 10:16 | 262K | |
![[ ]](/icons/layout.gif) | Public Service Regulation 2016 as at 1 November 2023.pdf | 2026-07-27 10:16 | 270K | |
![[ ]](/icons/layout.gif) | Green BCSA.pdf | 2026-07-27 10:16 | 279K | |
![[ ]](/icons/layout.gif) | national_policy_framework.pdf | 2026-07-27 10:15 | 288K | |
![[ ]](/icons/layout.gif) | Notice of the list of protected tree species__shortname.pdf | 2026-07-27 10:16 | 288K | |
![[ ]](/icons/layout.gif) | Housing Act.pdf | 2026-07-27 10:16 | 288K | |
![[ ]](/icons/layout.gif) | Housing_Act_107_of_1997.pdf | 2026-07-27 10:16 | 288K | |
![[ ]](/icons/layout.gif) | western-cape-provincial-school-education-amend-bills-b1-2018_final.pdf | 2026-07-27 10:16 | 290K | |
![[ ]](/icons/layout.gif) | Repeal of Proviso on Compulsory Offering of Accounting with Mathematics.pdf | 2026-07-27 10:16 | 293K | |
![[ ]](/icons/layout.gif) | Infrastructure development act_.pdf | 2026-07-27 10:16 | 298K | |
![[ ]](/icons/layout.gif) | bapela-stoop-2016-unpacking-the-rental-housing-amendment-act-35-of-2014 (3).pdf | 2026-07-27 10:16 | 304K | |
![[ ]](/icons/layout.gif) | SPLUMA.pdf | 2026-07-27 10:16 | 312K | |
![[ ]](/icons/layout.gif) | Amended-by-Cross-Boundary-Municipalities-Laws-Repeal-and-Related-Matters-Act-23-of-2005.pdf | 2026-07-27 10:16 | 312K | |
![[ ]](/icons/layout.gif) | Cross-boundary-Municipalities-Laws-Repeal-and-Related-Matters-Act-No-23-of-2005.pdf | 2026-07-27 10:16 | 312K | |
![[ ]](/icons/layout.gif) | Western Cape Commissioner for Children Act, 2019 (Act 2 of 2019).pdf | 2026-07-27 10:16 | 315K | |
![[ ]](/icons/layout.gif) | IS-52regulations.pdf | 2026-07-27 10:16 | 326K | |
![[ ]](/icons/layout.gif) | King-IV-Summary-1-November-2016.pdf | 2026-07-27 10:16 | 328K | |
![[ ]](/icons/layout.gif) | dsd-paia-manual-section-15-english-2025.pdf | 2026-07-27 10:16 | 334K | |
![[ ]](/icons/layout.gif) | Broad-based Black Economic Empowerment Act 53 of 2003.pdf | 2026-07-27 10:16 | 338K | |
![[ ]](/icons/layout.gif) | 24 Perishable Products Export Control No9 1983 ( scanned in by court).pdf | 2026-07-27 10:16 | 339K | |
![[ ]](/icons/layout.gif) | TLGFA-Traditional-Leadership-and-Governance-Framework-Act-2003-Act-No-41-of-2003.pdf | 2026-07-27 10:16 | 341K | |
![[ ]](/icons/layout.gif) | 9057-wc-registration-licence-fees-2025-1.pdf | 2026-07-27 10:15 | 347K | |
![[ ]](/icons/layout.gif) | General-Laws-Loss-of-Membership-Amendment-Act__shortname.pdf | 2026-07-27 10:16 | 350K | |
![[ ]](/icons/layout.gif) | research_study_on_the_demilitarisation_of_saps-policy_brief.pdf | 2026-07-27 10:16 | 353K | |
![[ ]](/icons/layout.gif) | guidelines_pppfa_regs_-_1_december_2011_(2).pdf | 2026-07-27 10:16 | 354K | |
![[ ]](/icons/layout.gif) | Amended-by-Local-Government-Municipal-Systems-Amendment-Act-7-of-2011.pdf | 2026-07-27 10:16 | 355K | |
![[ ]](/icons/layout.gif) | dsd-popia-compliance-framework-and-privacy-notice-2025-english - Copy.pdf | 2026-07-27 10:16 | 360K | |
![[ ]](/icons/layout.gif) | sp2010-english.pdf | 2026-07-27 10:16 | 360K | |
![[ ]](/icons/layout.gif) | MIG pdf.pdf | 2026-07-27 10:16 | 367K | |
![[ ]](/icons/layout.gif) | NDHS Proposed Language Policy - Final Draft_-.pdf | 2026-07-27 10:16 | 378K | |
![[ ]](/icons/layout.gif) | WC-CPF-INTRODUCTORY HANDBOOK-v022025.pdf | 2026-07-27 10:16 | 379K | |
![[ ]](/icons/layout.gif) | protection of personal information act.pdf | 2026-07-27 10:16 | 389K | |
![[ ]](/icons/layout.gif) | western_cape_policy_on_public_participation_2010.pdf | 2026-07-27 10:16 | 390K | |
![[ ]](/icons/layout.gif) | communal Property Associates Act.pdf | 2026-07-27 10:16 | 392K | |
![[ ]](/icons/layout.gif) | RENTAL HOUSING TRIBUNAL.pdf | 2026-07-27 10:16 | 393K | |
![[ ]](/icons/layout.gif) | National Environment Management Air Quality Act 39 of 2004.pdf | 2026-07-27 10:16 | 404K | |
![[ ]](/icons/layout.gif) | national environmental managment air quality act,2004.pdf | 2026-07-27 10:16 | 404K | |
![[ ]](/icons/layout.gif) | PFMA.pdf | 2026-07-27 10:16 | 426K | |
![[ ]](/icons/layout.gif) | compliance-notice-in-terms-of-section-83-3-d-of-paia.pdf | 2026-07-27 10:16 | 438K | |
![[ ]](/icons/layout.gif) | Mbambisa & Others v Nelson Mandela Bay Municipality_.pdf | 2026-07-27 10:16 | 450K | |
![[ ]](/icons/layout.gif) | Vote 33 Human Settlements.pdf | 2026-07-27 10:16 | 468K | |
![[ ]](/icons/layout.gif) | national landtransport amendment act 23 of 2023.pdf | 2026-07-27 10:15 | 473K | |
![[ ]](/icons/layout.gif) | Amended-by-Local-Government-Municipal-Structures-Amendment-Act-3-of-2021.pdf | 2026-07-27 10:16 | 481K | |
![[ ]](/icons/layout.gif) | the_act_-_act_no._1_of_2020_-_establishment_of_the_national_public_health_institute_of_south_africa (1).pdf | 2026-07-27 10:16 | 482K | |
![[ ]](/icons/layout.gif) | social.crime-prevention.brochure.pdf | 2026-07-27 10:16 | 483K | |
![[ ]](/icons/layout.gif) | REMUNERATION-OF-PUBLIC-OFFICE-BEARERS-ACT.pdf | 2026-07-27 10:16 | 484K | |
![[ ]](/icons/layout.gif) | MTSF 2014-2019_.pdf | 2026-07-27 10:16 | 492K | |
![[ ]](/icons/layout.gif) | 2015_policy_framework_-_services_to_persons_with_intellectial_disability_1.pdf | 2026-07-27 10:16 | 493K | |
![[ ]](/icons/layout.gif) | quarterly-consolidated-statement-on-municipal-finances-per-s71-7-of-the-mfma-q3-2024-25.pdf | 2026-07-27 10:15 | 506K | |
![[ ]](/icons/layout.gif) | National Environmental Management Act 107 of 1998.pdf | 2026-07-27 10:16 | 509K | |
![[ ]](/icons/layout.gif) | wcape-education-amend-bill2010.pdf | 2026-07-27 10:16 | 511K | |
![[ ]](/icons/layout.gif) | Policies Procedures expropriation of Land in terms of Act 126 and ESTA.pdf | 2026-07-27 10:16 | 521K | |
![[ ]](/icons/layout.gif) | Provincial Treasury Service Delivery Improvement Plan SDIP 2023_0.pdf | 2026-07-27 10:16 | 521K | |
![[ ]](/icons/layout.gif) | IPDMArt3ValueFormoney.pdf | 2026-07-27 10:16 | 525K | |
![[ ]](/icons/layout.gif) | evaluationpolicyframework-approved-11-11-23a.pdf | 2026-07-27 10:16 | 532K | |
![[ ]](/icons/layout.gif) | evaluation policy framework.pdf | 2026-07-27 10:16 | 532K | |
![[ ]](/icons/layout.gif) | No. 54 of 2003 Spatial Data Infrastructure Act, 2003.pdf | 2026-07-27 10:16 | 532K | |
![[ ]](/icons/layout.gif) | Western Cape Liquor Act, 2008, Act 4 of 2008.pdf | 2026-07-27 10:16 | 536K | |
![[ ]](/icons/layout.gif) | NLTF.pdf | 2026-07-27 10:16 | 568K | |
![[ ]](/icons/layout.gif) | greenpapernational-strategic-planning0.pdf | 2026-07-27 10:15 | 579K | |
![[ ]](/icons/layout.gif) | Consolidated WCGR Act 02122020 (003).pdf | 2026-07-27 10:16 | 580K | |
![[ ]](/icons/layout.gif) | RegCondAdminManageNSC.pdf | 2026-07-27 10:16 | 594K | |
![[ ]](/icons/layout.gif) | Policy Framework for the Recapitalization.pdf | 2026-07-27 10:16 | 595K | |
![[ ]](/icons/layout.gif) | scm_guidelines_Nat_Treasury.pdf | 2026-07-27 10:16 | 596K | |
![[ ]](/icons/layout.gif) | building_standards_act.pdf | 2026-07-27 10:16 | 599K | |
![[ ]](/icons/layout.gif) | Consumer Protection Act.pdf | 2026-07-27 10:16 | 612K | |
![[ ]](/icons/layout.gif) | Western-Cape-Biodiversity-Act-No.-6-of-2021-14-December-2021__shortname.pdf | 2026-07-27 10:16 | 620K | |
![[ ]](/icons/layout.gif) | national-skills-development-strategyiiia.pdf | 2026-07-27 10:16 | 621K | |
![[ ]](/icons/layout.gif) | Recapitalization and Development Programme Policy.pdf | 2026-07-27 10:16 | 623K | |
![[ ]](/icons/layout.gif) | revised-3rd-draft-rwp-ach-february-2017.pdf | 2026-07-27 10:16 | 634K | |
![[ ]](/icons/layout.gif) | PAM Act2014.pdf | 2026-07-27 10:16 | 635K | |
![[ ]](/icons/layout.gif) | BDM Booklet 1.pdf | 2026-07-27 10:16 | 638K | |
![[ ]](/icons/layout.gif) | NATIONAL STRATEGIC FRAMEWORK ON.pdf | 2026-07-27 10:16 | 638K | |
![[ ]](/icons/layout.gif) | IGR Framework Act 13 of 2005.pdf | 2026-07-27 10:15 | 639K | |
![[ ]](/icons/layout.gif) | Deeds Registries Act 47 of 1937.pdf | 2026-07-27 10:16 | 641K | |
![[ ]](/icons/layout.gif) | 73556-wcg-provincial-notice-20x7-eng-ctimes.pdf | 2026-07-27 10:16 | 641K | |
![[ ]](/icons/layout.gif) | western cape provincial school education act, 1997.pdf | 2026-07-27 10:16 | 645K | |
![[ ]](/icons/layout.gif) | SAConstitution-web-eng.pdf | 2026-07-27 10:15 | 649K | |
![[ ]](/icons/layout.gif) | Amended-by-Small-Business-Tax-Amnesty-and-Amendment-of-Taxation-Laws-Act-9-of-2006.pdf | 2026-07-27 10:16 | 649K | |
![[ ]](/icons/layout.gif) | 2025-paia-manual-eng.pdf | 2026-07-27 10:16 | 660K | |
![[ ]](/icons/layout.gif) | ENE Vote 33 Human Settlements for 2023.pdf | 2026-07-27 10:16 | 662K | |
![[ ]](/icons/layout.gif) | Provincial Media Policy.pdf | 2026-07-27 10:16 | 663K | |
![[ ]](/icons/layout.gif) | Integrated residential development program.pdf | 2026-07-27 10:16 | 684K | |
![[ ]](/icons/layout.gif) | Environmental Strategy.pdf | 2026-07-27 10:16 | 693K | |
![[ ]](/icons/layout.gif) | 044_-_policy_on_social_development_services_to_persons_with_disabilities_apr_2017.pdf | 2026-07-27 10:16 | 695K | |
![[ ]](/icons/layout.gif) | first_home_finance_presentation_ppra_2024_.pdf | 2026-07-27 10:15 | 699K | |
![[ ]](/icons/layout.gif) | Vote 09 - Environmental Affairs and Development Planning.pdf | 2026-07-27 10:16 | 711K | |
![[ ]](/icons/layout.gif) | Environmental Impact Assessment Regulations 2014.pdf | 2026-07-27 10:16 | 711K | |
![[ ]](/icons/layout.gif) | Smartworkers-infographic-English-in-house-printing-copy-1.pdf | 2026-07-27 10:16 | 713K | |
![[ ]](/icons/layout.gif) | Supervision-Framework-Booklet.pdf | 2026-07-27 10:16 | 726K | |
![[ ]](/icons/compressed.gif) | summaryfilesFromCR.zip | 2026-07-27 10:16 | 734K | |
![[ ]](/icons/layout.gif) | NSRP_final_august_2012.pdf | 2026-07-27 10:16 | 736K | |
![[ ]](/icons/layout.gif) | doi-final-annual report to citizen-2024-25.pdf | 2026-07-27 10:16 | 746K | |
![[ ]](/icons/layout.gif) | Policy on the Organisation, Roles and Responsibilities of Education Districts.pdf | 2026-07-27 10:16 | 755K | |
![[ ]](/icons/layout.gif) | paia-manual-dsd-2025.pdf | 2026-07-27 10:16 | 759K | |
![[ ]](/icons/layout.gif) | Tourism Sector Recovery Plan.pdf | 2026-07-27 10:16 | 769K | |
![[ ]](/icons/layout.gif) | FHF-BROCHURE-Sep-2023_WhatisFHF.pdf | 2026-07-27 10:16 | 778K | |
![[ ]](/icons/layout.gif) | RENTAL_HOUSING_ACT.pdf | 2026-07-27 10:16 | 789K | |
![[ ]](/icons/layout.gif) | South African Weather Service Act 8 of 2001.pdf | 2026-07-27 10:16 | 790K | |
![[ ]](/icons/layout.gif) | Social housing act.pdf | 2026-07-27 10:16 | 790K | |
![[ ]](/icons/layout.gif) | deadp-smartprocurement-analysis-report.pdf | 2026-07-27 10:16 | 796K | |
![[ ]](/icons/layout.gif) | 2022.04.21_oversight_report_2020_21_1.pdf | 2026-07-27 10:16 | 831K | |
![[ ]](/icons/layout.gif) | LOCAL-GOVERNMENT-LAWS-AMENDMENT-ACT.pdf | 2026-07-27 10:16 | 855K | |
![[ ]](/icons/layout.gif) | MTEF 2024 Guidelines.pdf | 2026-07-27 10:16 | 856K | |
![[ ]](/icons/layout.gif) | Delegation Principles for Financial Management act.pdf | 2026-07-27 10:16 | 858K | |
![[ ]](/icons/layout.gif) | Companies Act (Act 71 of 2008).pdf | 2026-07-27 10:16 | 860K | |
![[ ]](/icons/layout.gif) | a5-dsd-citizens-report-24_25-digital.pdf | 2026-07-27 10:16 | 897K | |
![[ ]](/icons/layout.gif) | PAIA.pdf | 2026-07-27 10:16 | 899K | |
![[ ]](/icons/layout.gif) | Promotion of Access to Information Act (PAIA) (Act 2 of 2000).pdf | 2026-07-27 10:16 | 899K | |
![[ ]](/icons/layout.gif) | policiy-and-criteria (1).pdf | 2026-07-27 10:16 | 908K | |
![[ ]](/icons/layout.gif) | policiy-and-criteria (2).pdf | 2026-07-27 10:16 | 908K | |
![[ ]](/icons/layout.gif) | policiy-and-criteria.pdf | 2026-07-27 10:16 | 908K | |
![[ ]](/icons/layout.gif) | Discount benefit scheme.pdf | 2026-07-27 10:16 | 926K | |
![[ ]](/icons/layout.gif) | wc-pbs_policy-july-2025.pdf | 2026-07-27 10:16 | 939K | |
![[ ]](/icons/layout.gif) | western_cape_department_of_social_development_youth_development_strategy_1.pdf | 2026-07-27 10:15 | 946K | |
![[ ]](/icons/layout.gif) | PIE-Amendment_Bill.pdf | 2026-07-27 10:16 | 954K | |
![[ ]](/icons/layout.gif) | human_resource_allocation_analyses_report.pdf | 2026-07-27 10:16 | 966K | |
![[ ]](/icons/layout.gif) | Subsidy social housing.pdf | 2026-07-27 10:16 | 967K | |
![[ ]](/icons/layout.gif) | National Education Policy Act Norms and standards for educators.pdf | 2026-07-27 10:16 | 1.0M | |
![[ ]](/icons/layout.gif) | National Small Enterprise Act (Act 102 of 1996).pdf | 2026-07-27 10:16 | 1.0M | |
![[ ]](/icons/layout.gif) | GRPB-framework-250119A.pdf | 2026-07-27 10:16 | 1.0M | |
![[ ]](/icons/layout.gif) | HousingConsAmendBill.2006.GG_.pdf | 2026-07-27 10:15 | 1.0M | |
![[ ]](/icons/layout.gif) | national-tourism-sector-strategy-2016-2026.pdf | 2026-07-27 10:16 | 1.0M | |
![[ ]](/icons/layout.gif) | Consolidation subsidy.pdf | 2026-07-27 10:16 | 1.0M | |
![[ ]](/icons/layout.gif) | Policy_Guideline_for_EPWP_final_10_2011.pdf | 2026-07-27 10:16 | 1.0M | |
![[ ]](/icons/layout.gif) | Reconstruction and Development Programme Fund Act 7 of 1994.pdf | 2026-07-27 10:16 | 1.1M | |
![[ ]](/icons/layout.gif) | National_Infrastructure_Plan.pdf | 2026-07-27 10:16 | 1.1M | |
![[ ]](/icons/layout.gif) | WCCCRS (CCC Response Strategy).pdf | 2026-07-27 10:16 | 1.1M | |
![[ ]](/icons/layout.gif) | supervision_framework_for_the_social_work_profession_in_south_africa_2012.pdf | 2026-07-27 10:16 | 1.1M | |
![[ ]](/icons/layout.gif) | NATIONAL NORMS AND STANDARDS FOR SCHOOL FUNDING (1).pdf | 2026-07-27 10:16 | 1.1M | |
![[ ]](/icons/layout.gif) | NATIONAL NORMS AND STANDARDS FOR SCHOOL FUNDING.pdf | 2026-07-27 10:16 | 1.1M | |
![[ ]](/icons/layout.gif) | western-cape-appropriation-act-2025.pdf | 2026-07-27 10:16 | 1.1M | |
![[ ]](/icons/layout.gif) | WCPP Revised Strategic Plan 202021-202425 (Revised Nov 2023).pdf | 2026-07-27 10:15 | 1.1M | |
![[ ]](/icons/layout.gif) | 251001Draft_Western_Cape_Safety_Plan_2025-2030_-_V3.0_-_22_Aug_2025.pdf | 2026-07-27 10:16 | 1.1M | |
![[ ]](/icons/layout.gif) | B21-2018 (Property Practitioners)_0.pdf | 2026-07-27 10:16 | 1.1M | |
![[ ]](/icons/layout.gif) | OneCape_2040.pdf | 2026-07-27 10:15 | 1.1M | |
![[ ]](/icons/layout.gif) | WC Climate Change Mitigation Scenarios__Energy_2015.pdf | 2026-07-27 10:16 | 1.1M | |
![[ ]](/icons/layout.gif) | Western Cape Climate Change Mitigation Scenarios for the Energy Scenarios_Report_2015.pdf | 2026-07-27 10:16 | 1.1M | |
![[ ]](/icons/layout.gif) | Community Residential Units_0.pdf | 2026-07-27 10:16 | 1.1M | |
![[ ]](/icons/layout.gif) | generic_norms_and_standards_for_social_welfare_services.pdf | 2026-07-27 10:16 | 1.2M | |
![[ ]](/icons/layout.gif) | State Information Technology Agency Act 88 of 1998.pdf | 2026-07-27 10:16 | 1.2M | |
![[ ]](/icons/layout.gif) | annual reports 2015-2020.pdf | 2026-07-27 10:16 | 1.2M | |
![[ ]](/icons/layout.gif) | NATIONAL EDUCATION POLICY ACT OF 1996.pdf | 2026-07-27 10:15 | 1.2M | |
![[ ]](/icons/layout.gif) | DEPARTMENT OF SOCIAL DEVELOPMENT REPUBLIC OF SOUTH.pdf | 2026-07-27 10:16 | 1.2M | |
![[ ]](/icons/layout.gif) | Housing_Amendment_Bill.pdf | 2026-07-27 10:16 | 1.2M | |
![[ ]](/icons/layout.gif) | Transforming Public Service Delivery White Paper (Batho Pele White Paper).pdf | 2026-07-27 10:16 | 1.2M | |
![[ ]](/icons/layout.gif) | Western Cape Climate Change Response Strategy_vision_2050_march_2022.pdf | 2026-07-27 10:16 | 1.2M | |
![[ ]](/icons/layout.gif) | first_home_finance_application_form.pdf | 2026-07-27 10:15 | 1.3M | |
![[ ]](/icons/layout.gif) | dpsastratframework2006-2015241120060.pdf | 2026-07-27 10:16 | 1.3M | |
![[ ]](/icons/layout.gif) | Upgrading of Land Tenure Rights Act.pdf | 2026-07-27 10:16 | 1.3M | |
![[ ]](/icons/layout.gif) | policy and implementation framewrok.pdf | 2026-07-27 10:16 | 1.3M | |
![[ ]](/icons/layout.gif) | PHP Policy Framework 2008.pdf | 2026-07-27 10:16 | 1.3M | |
![[ ]](/icons/layout.gif) | NATIONAL-DRUG-MASTER-PLAN_V5-2019-2024.pdf | 2026-07-27 10:16 | 1.3M | |
![[ ]](/icons/layout.gif) | drug-master-plan.pdf | 2026-07-27 10:16 | 1.3M | |
![[ ]](/icons/layout.gif) | WC EIIF GE Ref Group.pdf | 2026-07-27 10:16 | 1.4M | |
![[ ]](/icons/layout.gif) | NDC September 2021.pdf | 2026-07-27 10:16 | 1.4M | |
![[ ]](/icons/layout.gif) | National Environmental Management Protected Areas Act 57 of 2003.pdf | 2026-07-27 10:16 | 1.4M | |
![[ ]](/icons/layout.gif) | drowning_framework.pdf | 2026-07-27 10:16 | 1.4M | |
![[ ]](/icons/layout.gif) | Evaluation of the Impact of the Rural Housing Programme.pdf | 2026-07-27 10:16 | 1.4M | |
![[ ]](/icons/layout.gif) | IUDF-2016_WEB-min.pdf | 2026-07-27 10:16 | 1.4M | |
![[ ]](/icons/layout.gif) | Medium Term Budget Policy Statement 2020.pdf | 2026-07-27 10:16 | 1.4M | |
![[ ]](/icons/layout.gif) | NIP 2050.pdf | 2026-07-27 10:16 | 1.4M | |
![[ ]](/icons/layout.gif) | Supply Chain Management Policy.pdf | 2026-07-27 10:16 | 1.5M | |
![[ ]](/icons/layout.gif) | 201111Final_Cabinet_Approved_NYP_2020-2030_19_October_2020.pdf | 2026-07-27 10:16 | 1.5M | |
![[ ]](/icons/layout.gif) | national Youth Policy.pdf | 2026-07-27 10:15 | 1.5M | |
![[ ]](/icons/layout.gif) | 37119gon953.pdf | 2026-07-27 10:16 | 1.5M | |
![[ ]](/icons/layout.gif) | DTPW Annual Performance Plan Afrikaans 2019-2020.pdf | 2026-07-27 10:16 | 1.6M | |
![[ ]](/icons/layout.gif) | financial recovery Plan November 2021.pdf | 2026-07-27 10:16 | 1.6M | |
![[ ]](/icons/layout.gif) | sectional Titles managment act,2011.pdf | 2026-07-27 10:16 | 1.6M | |
![[ ]](/icons/layout.gif) | Social Housing-Regulations-Booklet_.pdf | 2026-07-27 10:16 | 1.6M | |
![[ ]](/icons/layout.gif) | Sectional titles schemes ACt.pdf | 2026-07-27 10:16 | 1.7M | |
![[ ]](/icons/layout.gif) | Environment2017.pdf | 2026-07-27 10:16 | 1.7M | |
![[ ]](/icons/layout.gif) | Human_settlements_MSP_final_document_25_May (1).pdf | 2026-07-27 10:16 | 1.7M | |
![[ ]](/icons/layout.gif) | National Veld and Forest Fire Act 101 of 1998.pdf | 2026-07-27 10:16 | 1.8M | |
![[ ]](/icons/layout.gif) | white paper Gazetted 31 January 2025.pdf | 2026-07-27 10:16 | 1.8M | |
![[ ]](/icons/layout.gif) | Cannabis implementation plan.pdf | 2026-07-27 10:16 | 1.8M | |
![[ ]](/icons/layout.gif) | final-alternative-and-blended-finance-framework-22.04.2025.pdf | 2026-07-27 10:15 | 1.8M | |
![[ ]](/icons/layout.gif) | NLTF 2023-2028.pdf | 2026-07-27 10:16 | 1.8M | |
![[ ]](/icons/layout.gif) | National Environmental Management Waste Act 59 of 2008.pdf | 2026-07-27 10:16 | 1.9M | |
![[ ]](/icons/layout.gif) | Framework for Managing Programme Performance Information.pdf | 2026-07-27 10:15 | 1.9M | |
![[ ]](/icons/layout.gif) | 8359-extra-wc-environmental-implementation.pdf | 2026-07-27 10:16 | 2.0M | |
![[ ]](/icons/layout.gif) | PSP_western_cape_strategic_plan_2019-2024 (PSP).pdf | 2026-07-27 10:16 | 2.0M | |
![[ ]](/icons/layout.gif) | western_cape_strategic_plan_2019-2024_1.pdf | 2026-07-27 10:16 | 2.0M | |
![[ ]](/icons/layout.gif) | Disaster Management Act 57 of 2002.pdf | 2026-07-27 10:16 | 2.1M | |
![[ ]](/icons/layout.gif) | handbook_for_municipal_councillors_.pdf | 2026-07-27 10:16 | 2.2M | |
![[ ]](/icons/layout.gif) | Approved DHS AR 2019-2020-2026.pdf | 2026-07-27 10:16 | 2.2M | |
![[ ]](/icons/layout.gif) | act85of1993.pdf | 2026-07-27 10:16 | 2.2M | |
![[ ]](/icons/layout.gif) | National Environmental Management Integrated Coastal__shortname.pdf | 2026-07-27 10:16 | 2.3M | |
![[ ]](/icons/layout.gif) | rental housing tribunal-annual-report-2024-2025-final.pdf | 2026-07-27 10:16 | 2.3M | |
![[ ]](/icons/layout.gif) | No. 5 of 2009 National Land Transport Act, 2009.pdf | 2026-07-27 10:16 | 2.3M | |
![[ ]](/icons/layout.gif) | final-annual-operational-2025-26__DOI.pdf | 2026-07-27 10:16 | 2.4M | |
![[ ]](/icons/layout.gif) | WCGRB Strategic Plan 2025-2030.pdf | 2026-07-27 10:16 | 2.4M | |
![[ ]](/icons/layout.gif) | ndzena-digital-future-skills-strategy.pdf | 2026-07-27 10:16 | 2.4M | |
![[ ]](/icons/layout.gif) | Policy on Learner Attendance 2010.pdf | 2026-07-27 10:16 | 2.4M | |
![[ ]](/icons/layout.gif) | dsd-strategic-plan-2025-2030_0.pdf | 2026-07-27 10:16 | 2.4M | |
![[ ]](/icons/layout.gif) | National Environmental Management Biodiversity Act 10 of 2004.pdf | 2026-07-27 10:16 | 2.4M | |
![[ ]](/icons/layout.gif) | pre-emptive-right-policy.pdf | 2026-07-27 10:16 | 2.5M | |
![[ ]](/icons/layout.gif) | CT_Spatial_Development_Framework.pdf | 2026-07-27 10:16 | 2.5M | |
![[ ]](/icons/layout.gif) | Strategic Plan-2025-30.pdf | 2026-07-27 10:15 | 2.6M | |
![[ ]](/icons/layout.gif) | Strategic Plan-2025-30__Economic_dev.pdf | 2026-07-27 10:16 | 2.6M | |
![[ ]](/icons/layout.gif) | Strategic Plan-2025-30__eco_dev_Tourism.pdf | 2026-07-27 10:16 | 2.6M | |
![[ ]](/icons/layout.gif) | nised-masterplan.pdf | 2026-07-27 10:16 | 2.6M | |
![[ ]](/icons/layout.gif) | implementation framework.pdf | 2026-07-27 10:16 | 2.7M | |
![[ ]](/icons/layout.gif) | DEP Human Settlements Annual Report 2016-17.pdf | 2026-07-27 10:15 | 2.7M | |
![[ ]](/icons/layout.gif) | TOWARDS POLICY FOUNDATION FOR THEHUMAN SETTLEMENTS LEGILATION - 01 NOVEMBER 2015(3) (1).pdf | 2026-07-27 10:16 | 2.9M | |
![[ ]](/icons/layout.gif) | WEB-2025-Sustainable-Agriculture-MIR.pdf | 2026-07-27 10:16 | 3.0M | |
![[ ]](/icons/layout.gif) | National-Integrated-ICT-Policy.pdf | 2026-07-27 10:16 | 3.3M | |
![[ ]](/icons/layout.gif) | western_cape_youth_development_strategy.pdf | 2026-07-27 10:15 | 3.3M | |
![[ ]](/icons/layout.gif) | wc-pdmc-annual-report-202425.pdf | 2026-07-27 10:16 | 3.3M | |
![[ ]](/icons/layout.gif) | Annual Performance Plan 2025-26.pdf | 2026-07-27 10:15 | 3.3M | |
![[ ]](/icons/layout.gif) | Annual Performance Plan 2025-26__Economic_dev.pdf | 2026-07-27 10:16 | 3.3M | |
![[ ]](/icons/layout.gif) | provincial-spatial-development-framework.pdf | 2026-07-27 10:16 | 3.3M | |
![[ ]](/icons/layout.gif) | Digital-Economy-Masterplan-22-Feb-2021v1_updated.pdf | 2026-07-27 10:16 | 3.4M | |
![[ ]](/icons/layout.gif) | Climate Science Input into Municipal Plans_Report_2014_0.pdf | 2026-07-27 10:16 | 3.5M | |
![[ ]](/icons/layout.gif) | Agenda 2063.pdf | 2026-07-27 10:15 | 3.5M | |
![[ ]](/icons/layout.gif) | Agenda 2063_The_Africa.pdf | 2026-07-27 10:16 | 3.5M | |
![[ ]](/icons/layout.gif) | wc-provincial-treasury-2022_23-annual-report.pdf | 2026-07-27 10:16 | 3.6M | |
![[ ]](/icons/layout.gif) | DHS FINAL 2025-30 STRATEGIC PLAN 31 MARCH 2025.pdf | 2026-07-27 10:16 | 3.7M | |
![[ ]](/icons/layout.gif) | dsd-annual-performance-plan-2025-26.pdf | 2026-07-27 10:16 | 3.7M | |
![[ ]](/icons/layout.gif) | CCA-Africa-Final.pdf | 2026-07-27 10:16 | 3.7M | |
![[ ]](/icons/layout.gif) | Alternative and Sustainable Infrastructure Solutions for Human Settlements_Study_2017.pdf | 2026-07-27 10:16 | 3.7M | |
![[ ]](/icons/layout.gif) | wced-sector-analysis_website.pdf | 2026-07-27 10:16 | 3.8M | |
![[ ]](/icons/layout.gif) | White Paper for Social Welfare (1997).pdf | 2026-07-27 10:15 | 3.8M | |
![[ ]](/icons/layout.gif) | White Paper on Population Policy (1998).pdf | 2026-07-27 10:16 | 3.8M | |
![[ ]](/icons/layout.gif) | REPORT FLISP.pdf | 2026-07-27 10:16 | 3.8M | |
![[ ]](/icons/layout.gif) | annual-performance-plan_2024-25__DLG.pdf | 2026-07-27 10:16 | 4.0M | |
![[ ]](/icons/layout.gif) | dlg-annual-performance-plan_2024-25_english.pdf | 2026-07-27 10:15 | 4.0M | |
![[ ]](/icons/layout.gif) | contractor-development-programme.pdf | 2026-07-27 10:16 | 4.0M | |
![[ ]](/icons/layout.gif) | 26082014_BNG2004_0.pdf | 2026-07-27 10:16 | 4.1M | |
![[ ]](/icons/layout.gif) | BNG Housing.pdf | 2026-07-27 10:16 | 4.1M | |
![[ ]](/icons/layout.gif) | Breaking New Ground.pdf | 2026-07-27 10:16 | 4.1M | |
![[ ]](/icons/layout.gif) | Revised Framework for Strategic Plans and Annual Performance Plans.pdf | 2026-07-27 10:16 | 4.2M | |
![[ ]](/icons/layout.gif) | 2020 - 2025 NDHS STRATEGIC PLAN.pdf | 2026-07-27 10:16 | 4.3M | |
![[ ]](/icons/layout.gif) | PAIA_Manual.pdf | 2026-07-27 10:16 | 4.3M | |
![[ ]](/icons/layout.gif) | GBCSA-Certification-Pricing-Brochure-FA.pdf | 2026-07-27 10:16 | 4.3M | |
![[ ]](/icons/layout.gif) | Human Setllement AR2024.pdf | 2026-07-27 10:16 | 4.3M | |
![[ ]](/icons/layout.gif) | Human Setllement AR2024 Website.pdf | 2026-07-27 10:15 | 4.3M | |
![[ ]](/icons/layout.gif) | IDP FULL REPORT-09-2022.pdf | 2026-07-27 10:16 | 4.4M | |
![[ ]](/icons/layout.gif) | REDBOOK_Part_1_(Planning & design guidelines).pdf | 2026-07-27 10:16 | 4.6M | |
![[ ]](/icons/layout.gif) | Stormwater.pdf | 2026-07-27 10:16 | 4.7M | |
![[ ]](/icons/layout.gif) | final-wcmd-strategic-plan-2025_2030 (1).pdf | 2026-07-27 10:16 | 4.7M | |
![[ ]](/icons/layout.gif) | final-wcmd-strategic-plan-2025_2030.pdf | 2026-07-27 10:15 | 4.7M | |
![[ ]](/icons/layout.gif) | DHSS.pdf | 2026-07-27 10:16 | 4.9M | |
![[ ]](/icons/layout.gif) | pocs-strategic-plan-2025-2030.pdf | 2026-07-27 10:15 | 5.0M | |
![[ ]](/icons/layout.gif) | pocs-strategic-plan-2025-2030_0.pdf | 2026-07-27 10:16 | 5.0M | |
![[ ]](/icons/layout.gif) | Green_Economy_Report 2022_Final.pdf | 2026-07-27 10:16 | 5.0M | |
![[ ]](/icons/layout.gif) | DHS_21-22 AR.pdf | 2026-07-27 10:16 | 5.2M | |
![[ ]](/icons/layout.gif) | A-Just-Transition-Framework-for-South-Africa-2022.pdf | 2026-07-27 10:16 | 5.2M | |
![[ ]](/icons/layout.gif) | wced-app-2024-2025.pdf | 2026-07-27 10:16 | 5.3M | |
![[ ]](/icons/layout.gif) | MFMA.pdf | 2026-07-27 10:16 | 5.3M | |
![[ ]](/icons/layout.gif) | wcdhw-annual-report-2024-2025.pdf | 2026-07-27 10:15 | 5.4M | |
![[ ]](/icons/layout.gif) | WC Sustainable Water Management Plan 2018.pdf | 2026-07-27 10:16 | 5.4M | |
![[ ]](/icons/layout.gif) | National development Plan 2030.pdf | 2026-07-27 10:16 | 5.6M | |
![[ ]](/icons/layout.gif) | wced-app-2023-2024.pdf | 2026-07-27 10:15 | 5.7M | |
![[ ]](/icons/layout.gif) | SA SDG Country Report 2023.pdf | 2026-07-27 10:16 | 5.7M | |
![[ ]](/icons/layout.gif) | IDP_Annual_Report.pdf | 2026-07-27 10:16 | 5.8M | |
![[ ]](/icons/layout.gif) | MTDP 2024-2029 Final Edit Version - 11 March 2025.pdf | 2026-07-27 10:15 | 5.8M | |
![[ ]](/icons/layout.gif) | MTFonSPPReportCSD19FINAL.pdf | 2026-07-27 10:16 | 6.0M | |
![[ ]](/icons/layout.gif) | wcg_dea-dp_annual-report_17-september-2025-website.pdf | 2026-07-27 10:15 | 6.0M | |
![[ ]](/icons/layout.gif) | DTPW Annual Performance Plan 2022-2023.pdf | 2026-07-27 10:16 | 6.2M | |
![[ ]](/icons/layout.gif) | WCGHW-Annual-Report-2017_2018_0.pdf | 2026-07-27 10:16 | 6.2M | |
![[ ]](/icons/layout.gif) | constitution of republic of RSA.pdf | 2026-07-27 10:15 | 6.2M | |
![[ ]](/icons/layout.gif) | dsd-annual-report-24_25.pdf | 2026-07-27 10:16 | 6.3M | |
![[ ]](/icons/layout.gif) | wcmd-annual-report-24-25-english.pdf | 2026-07-27 10:15 | 6.4M | |
![[ ]](/icons/layout.gif) | PLTF Western Cape 2024-2028 20250721.pdf | 2026-07-27 10:16 | 6.4M | |
![[ ]](/icons/layout.gif) | Framework-on-Gender-Responsive-Planning-Budgeting-Monitoring-Evaluation-and-Auditing (1).pdf | 2026-07-27 10:16 | 6.6M | |
![[ ]](/icons/layout.gif) | Framework-on-Gender-Responsive-Planning-Budgeting-Monitoring-Evaluation-and-Auditing.pdf | 2026-07-27 10:16 | 6.6M | |
![[ ]](/icons/layout.gif) | SDG_Country_report.pdf | 2026-07-27 10:16 | 6.8M | |
![[ ]](/icons/layout.gif) | industrial-policy-action-plan.pdf | 2026-07-27 10:16 | 6.8M | |
![[ ]](/icons/layout.gif) | DTPW Annual Performance Plan 2020-2021.pdf | 2026-07-27 10:16 | 7.1M | |
![[ ]](/icons/layout.gif) | hazardous substance act.pdf | 2026-07-27 10:16 | 7.3M | |
![[ ]](/icons/layout.gif) | WCGHW-Annual-Report_2021-2022.pdf | 2026-07-27 10:16 | 7.4M | |
![[ ]](/icons/layout.gif) | wc-provincial-treasury-2024_25-annual-report.pdf | 2026-07-27 10:15 | 7.4M | |
![[ ]](/icons/layout.gif) | annual performance plan 2025-2026.pdf | 2026-07-27 10:16 | 7.4M | |
![[ ]](/icons/layout.gif) | pocs-app-2025-26_1.pdf | 2026-07-27 10:16 | 7.4M | |
![[ ]](/icons/layout.gif) | Public Service Act Regulations amendments as gazzeted on the 20 Oct 2023.pdf | 2026-07-27 10:15 | 7.5M | |
![[ ]](/icons/layout.gif) | DTPW Annual Report 2021-2022.pdf | 2026-07-27 10:16 | 7.7M | |
![[ ]](/icons/layout.gif) | 2025-Water-MIR-Final.pdf | 2026-07-27 10:16 | 7.7M | |
![[ ]](/icons/layout.gif) | dpocs_app_2024-25.pdf | 2026-07-27 10:16 | 7.8M | |
![[ ]](/icons/layout.gif) | 2025-Renewable-Energy-MIR-regional-Final.pdf | 2026-07-27 10:16 | 8.2M | |
![[ ]](/icons/layout.gif) | ME-Evidence-Informing-Budgets-and-Planning-Guideline-SA.pdf | 2026-07-27 10:16 | 8.6M | |
![[ ]](/icons/layout.gif) | FINAL EDITED 12-2021 BASELINE EVALUATION OF IS TARGETED FOR UPGRADE_REPORT 28-01-20221 (1) (1).pdf | 2026-07-27 10:16 | 8.7M | |
![[ ]](/icons/layout.gif) | White2520on2520rights2520person2520disabilities_25202015.pdf | 2026-07-27 10:16 | 8.8M | |
![[ ]](/icons/layout.gif) | BASELINE EVALUATION OF IS TARGETED FOR UPGRADE.pdf | 2026-07-27 10:16 | 8.9M | |
![[ ]](/icons/layout.gif) | wced-strategic-plan-2025-2030.pdf | 2026-07-27 10:15 | 9.0M | |
![[ ]](/icons/layout.gif) | SmartAgri-Climate-Change.pdf | 2026-07-27 10:16 | 9.3M | |
![[ ]](/icons/layout.gif) | MSDF_Vol_I_Ch1-6_Tech_Suppl_A.pdf | 2026-07-27 10:16 | 10M | |
![[ ]](/icons/layout.gif) | wcghw-annual-report-2023-2024.pdf | 2026-07-27 10:16 | 10M | |
![[ ]](/icons/layout.gif) | annaul performance Plan.pdf | 2026-07-27 10:16 | 10M | |
![[ ]](/icons/layout.gif) | vote-3-strategic-plan-2025_30-provincial-treasury-copy.pdf | 2026-07-27 10:16 | 10M | |
![[ ]](/icons/layout.gif) | Climate Change Response Strategy_M&E Report_2015-16.pdf | 2026-07-27 10:16 | 11M | |
![[ ]](/icons/layout.gif) | wced-stratplan-2020-2025.pdf | 2026-07-27 10:15 | 11M | |
![[ ]](/icons/layout.gif) | wcdhw_sp_strategic_plan_2025-2030_digital.pdf | 2026-07-27 10:16 | 11M | |
![[ ]](/icons/layout.gif) | Annual report 2024 2025__Cultural.pdf | 2026-07-27 10:16 | 11M | |
![[ ]](/icons/layout.gif) | Legal succesion to the South African Transport Service Act.pdf | 2026-07-27 10:16 | 11M | |
![[ ]](/icons/layout.gif) | wced-app-2025-2026.pdf | 2026-07-27 10:15 | 12M | |
![[ ]](/icons/layout.gif) | ebp_resource_guide_final_complete_new_0.pdf | 2026-07-27 10:16 | 12M | |
![[ ]](/icons/layout.gif) | medium term developmen plan (MTDP) 2024-2029.pdf | 2026-07-27 10:16 | 12M | |
![[ ]](/icons/layout.gif) | medium term development plan 2024-2029.pdf | 2026-07-27 10:16 | 12M | |
![[ ]](/icons/layout.gif) | MTDP 2024-2029 .pdf | 2026-07-27 10:16 | 12M | |
![[ ]](/icons/layout.gif) | psp-2025-30.pdf | 2026-07-27 10:16 | 13M | |
![[ ]](/icons/layout.gif) | MOIP-challenges-and-opportunities-working-paper-2017-1.pdf | 2026-07-27 10:16 | 13M | |
![[ ]](/icons/layout.gif) | 2025-03-26-gmt-strategic-plan-2025-2030-digital-version.pdf | 2026-07-27 10:15 | 13M | |
![[ ]](/icons/layout.gif) | Strategic plan 2025-2030__agriculture.pdf | 2026-07-27 10:16 | 17M | |
![[ ]](/icons/layout.gif) | strategic plan 2025-2030.pdf | 2026-07-27 10:15 | 17M | |
![[ ]](/icons/layout.gif) | Energy Consumption &CO2e Emissions Database WC - Web.pdf | 2026-07-27 10:16 | 17M | |
![[ ]](/icons/layout.gif) | Annual report 2024-2025__agriculture.pdf | 2026-07-27 10:16 | 17M | |
![[ ]](/icons/layout.gif) | annual report 2024-2025.pdf | 2026-07-27 10:15 | 17M | |
![[ ]](/icons/layout.gif) | 13357-dedat-annual-report_full-report.pdf | 2026-07-27 10:16 | 17M | |
![[ ]](/icons/layout.gif) | STATE OF ENVIRONMENT OUTLOOK REPORT FOR THE WESTERN CAPE 2013.pdf | 2026-07-27 10:16 | 18M | |
![[ ]](/icons/layout.gif) | STATE OF ENVIRONMENT OUTLOOK REPORT FOR THE WESTERN CAPE 2013_.pdf | 2026-07-27 10:16 | 18M | |
![[ ]](/icons/layout.gif) | Road Transportation Act 74 of 1977.pdf | 2026-07-27 10:15 | 18M | |
![[ ]](/icons/layout.gif) | NDP-2030-our-future-make-it-workr.pdf | 2026-07-27 10:16 | 19M | |
![[ ]](/icons/layout.gif) | NPC-National-Development-Plan-Vision-2030.pdf | 2026-07-27 10:15 | 19M | |
![[ ]](/icons/layout.gif) | WC Climate Change Response Strategy Biennial M&E Report (2017-18)_1 (1).pdf | 2026-07-27 10:16 | 21M | |
![[ ]](/icons/layout.gif) | WCSDF 2014 PSDF Annexures (3).pdf | 2026-07-27 10:16 | 22M | |
![[ ]](/icons/layout.gif) | WCSDF 2014 PSDF Annexures.pdf | 2026-07-27 10:16 | 22M | |
![[ ]](/icons/layout.gif) | vote-3-annual-performance-plan-2025_26-provincial-treasury-copy.pdf | 2026-07-27 10:16 | 22M | |
![[ ]](/icons/layout.gif) | Development Facilitation Act_.pdf | 2026-07-27 10:16 | 22M | |
![[ ]](/icons/layout.gif) | Growth-for-Jobs-Strategy-2023-Cabinet-Approved.pdf | 2026-07-27 10:16 | 26M | |
![[ ]](/icons/layout.gif) | NSDF.pdf | 2026-07-27 10:16 | 27M | |
![[ ]](/icons/layout.gif) | Rural Economy Transformation Model.pdf | 2026-07-27 10:15 | 28M | |
![[ ]](/icons/layout.gif) | department-of-the-premier-strategic-plan-2025-2030.pdf | 2026-07-27 10:15 | 39M | |
![[ ]](/icons/layout.gif) | WCIS2050 V4_Final.pdf | 2026-07-27 10:16 | 44M | |
![[ ]](/icons/layout.gif) | WCIS__2050 V4_Final.pdf | 2026-07-27 10:16 | 44M | |
![[ ]](/icons/layout.gif) | V10 - WCIF_ 1.pdf | 2026-07-27 10:16 | 64M | |
![[ ]](/icons/layout.gif) | WCIF__V10 - WCIF_ 1.pdf | 2026-07-27 10:16 | 64M | |
![[ ]](/icons/layout.gif) | V4 FINAL_ WCIIP 2050.pdf | 2026-07-27 10:16 | 80M | |
![[ ]](/icons/layout.gif) | WCIIP__V4 FINAL_ WCIIP 2050.pdf | 2026-07-27 10:16 | 80M | |
![[ ]](/icons/compressed.gif) | 1. EVEs knowledge base.zip | 2026-07-27 10:15 | 483M | |
![[ ]](/icons/compressed.gif) | qa_server_pdf_files.zip | 2026-07-27 10:16 | 737M | |
|